The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(RS)-4-[1-(2,3-dichlorophenoxy)pentyl]-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine ID: ALA4873127
PubChem CID: 164624803
Max Phase: Preclinical
Molecular Formula: C19H26Cl2N6O
Molecular Weight: 425.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(Oc1cccc(Cl)c1Cl)c1nc(N)nc(N2CCN(C)CC2)n1
Standard InChI: InChI=1S/C19H26Cl2N6O/c1-3-4-7-15(28-14-8-5-6-13(20)16(14)21)17-23-18(22)25-19(24-17)27-11-9-26(2)10-12-27/h5-6,8,15H,3-4,7,9-12H2,1-2H3,(H2,22,23,24,25)
Standard InChI Key: KPRWGLQDBYNALG-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
15.7192 -12.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7181 -13.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4328 -14.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1493 -13.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1464 -12.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4310 -12.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8644 -14.0297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5782 -13.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2933 -14.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2900 -14.8509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0042 -15.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7191 -14.8486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7150 -14.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0003 -13.6117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4275 -13.6032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0051 -16.0872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2911 -16.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7201 -16.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7209 -17.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2920 -17.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0069 -17.7372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0078 -18.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4326 -14.8566 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.0032 -14.0307 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.5769 -12.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2908 -12.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2894 -11.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0033 -11.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
13 15 1 0
11 16 1 0
16 17 1 0
16 18 1 0
18 19 1 0
17 20 1 0
19 21 1 0
21 20 1 0
21 22 1 0
3 23 1 0
2 24 1 0
8 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.36Molecular Weight (Monoisotopic): 424.1545AlogP: 3.82#Rotatable Bonds: 7Polar Surface Area: 80.40Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.07CX LogP: 5.29CX LogD: 5.12Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.72Np Likeness Score: -0.99
References 1. Sudoł S, Kucwaj-Brysz K, Kurczab R, Wilczyńska N, Jastrzębska-Więsek M, Satała G, Latacz G, Głuch-Lutwin M, Mordyl B, Żesławska E, Nitek W, Partyka A, Buzun K, Doroz-Płonka A, Wesołowska A, Bielawska A, Handzlik J.. (2020) Chlorine substituents and linker topology as factors of 5-HT6 R activity for novel highly active 1,3,5-triazine derivatives with procognitive properties in vivo., 203 [PMID:32693296 ] [10.1016/j.ejmech.2020.112529 ]