The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-15-beta-acetoxymethyl-16-oxobeyeran-19-oic acid ID: ALA4873151
PubChem CID: 164624813
Max Phase: Preclinical
Molecular Formula: C23H34O5
Molecular Weight: 390.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@@H]1C(=O)[C@@]2(C)CC[C@H]3[C@]4(C)CCC[C@@](C)(C(=O)O)[C@H]4CC[C@@]13C2
Standard InChI: InChI=1S/C23H34O5/c1-14(24)28-12-15-18(25)20(2)10-6-17-21(3)8-5-9-22(4,19(26)27)16(21)7-11-23(15,17)13-20/h15-17H,5-13H2,1-4H3,(H,26,27)/t15-,16+,17+,20+,21-,22-,23-/m1/s1
Standard InChI Key: FAKKAXFHAKHBIW-UQRNBJPMSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.5472 -3.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1477 -3.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9483 -3.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8543 -2.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8543 -2.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5472 -1.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2360 -2.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2325 -2.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9222 -3.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6199 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -1.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6234 -2.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3188 -1.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3303 -0.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6402 -0.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9345 -0.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5488 -4.5893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7490 -3.8926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5353 -2.4020 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9221 -2.4062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.0308 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2287 -1.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3088 -2.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0228 -1.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7968 -1.0145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6841 -3.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4885 -3.1453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8646 -3.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6648 -3.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4404 -4.5310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
3 17 1 0
3 18 2 0
8 19 1 1
11 20 1 1
14 21 1 1
7 22 1 6
12 23 1 0
14 24 1 0
23 24 1 0
24 25 2 0
23 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.52Molecular Weight (Monoisotopic): 390.2406AlogP: 4.23#Rotatable Bonds: 3Polar Surface Area: 80.67Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.50CX Basic pKa: ┄CX LogP: 4.20CX LogD: 1.40Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: 2.42
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]