Ent-15-beta-acetoxymethyl-16-oxobeyeran-19-oic acid

ID: ALA4873151

PubChem CID: 164624813

Max Phase: Preclinical

Molecular Formula: C23H34O5

Molecular Weight: 390.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)OC[C@@H]1C(=O)[C@@]2(C)CC[C@H]3[C@]4(C)CCC[C@@](C)(C(=O)O)[C@H]4CC[C@@]13C2

Standard InChI:  InChI=1S/C23H34O5/c1-14(24)28-12-15-18(25)20(2)10-6-17-21(3)8-5-9-22(4,19(26)27)16(21)7-11-23(15,17)13-20/h15-17H,5-13H2,1-4H3,(H,26,27)/t15-,16+,17+,20+,21-,22-,23-/m1/s1

Standard InChI Key:  FAKKAXFHAKHBIW-UQRNBJPMSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.5472   -3.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1477   -3.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9483   -3.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8543   -2.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8543   -2.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5472   -1.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2360   -2.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2325   -2.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9222   -3.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6199   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -1.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6234   -2.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3188   -1.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3303   -0.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6402   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9345   -0.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5488   -4.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7490   -3.8926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5353   -2.4020    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9221   -2.4062    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0308   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2287   -1.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3088   -2.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0228   -1.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7968   -1.0145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6841   -3.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4885   -3.1453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8646   -3.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6648   -3.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4404   -4.5310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  4  6  1  0
  5  1  1  0
  1  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
  3 17  1  0
  3 18  2  0
  8 19  1  1
 11 20  1  1
 14 21  1  1
  7 22  1  6
 12 23  1  0
 14 24  1  0
 23 24  1  0
 24 25  2  0
 23 26  1  1
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4873151

    ---

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.52Molecular Weight (Monoisotopic): 390.2406AlogP: 4.23#Rotatable Bonds: 3
Polar Surface Area: 80.67Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.50CX Basic pKa: CX LogP: 4.20CX LogD: 1.40
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: 2.42

References

1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y..  (2021)  Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents.,  219  [PMID:33862515] [10.1016/j.ejmech.2021.113396]

Source