2-(4-fluorophenyl)-N-((2-(4-methylpiperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)methyl)acetamide

ID: ALA4873214

PubChem CID: 25123709

Max Phase: Preclinical

Molecular Formula: C21H23F4N3O

Molecular Weight: 409.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CCN(c2nc(C(F)(F)F)ccc2CNC(=O)Cc2ccc(F)cc2)CC1

Standard InChI:  InChI=1S/C21H23F4N3O/c1-14-8-10-28(11-9-14)20-16(4-7-18(27-20)21(23,24)25)13-26-19(29)12-15-2-5-17(22)6-3-15/h2-7,14H,8-13H2,1H3,(H,26,29)

Standard InChI Key:  VPBOZDLXLZCUTE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   29.7849   -2.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7838   -2.8355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4985   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2150   -2.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2122   -2.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4968   -1.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0704   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0702   -0.7710    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.3560   -2.0085    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.3531   -1.1833    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.4983   -4.0734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7826   -4.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7804   -5.3009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4929   -5.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2092   -5.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2132   -4.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4895   -6.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9301   -3.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6439   -2.8328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3590   -3.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0727   -2.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3602   -4.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7879   -3.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7847   -4.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4990   -4.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2137   -4.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2098   -3.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4949   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9294   -4.4756    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  3 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
  4 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
M  END

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.43Molecular Weight (Monoisotopic): 409.1777AlogP: 4.33#Rotatable Bonds: 5
Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.51CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -1.67

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source