The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(2-chlorophenyl)piperazin-1-yl)-6-(4-methoxyphenyl)-2-oxo-2H-pyran-3-carbonitrile ID: ALA4873233
PubChem CID: 164620380
Max Phase: Preclinical
Molecular Formula: C23H20ClN3O3
Molecular Weight: 421.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(N3CCN(c4ccccc4Cl)CC3)c(C#N)c(=O)o2)cc1
Standard InChI: InChI=1S/C23H20ClN3O3/c1-29-17-8-6-16(7-9-17)22-14-21(18(15-25)23(28)30-22)27-12-10-26(11-13-27)20-5-3-2-4-19(20)24/h2-9,14H,10-13H2,1H3
Standard InChI Key: PAGMGOFYPSRNPE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
12.2039 -31.7380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9159 -31.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9159 -30.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2039 -30.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4918 -31.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4872 -30.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2070 -29.2629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6316 -30.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3473 -29.6838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6298 -31.7432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9302 -28.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9353 -28.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2242 -27.6142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5064 -28.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4996 -28.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2304 -26.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9498 -26.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9563 -25.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2445 -25.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5245 -25.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5214 -26.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6600 -26.8053 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.7791 -31.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0658 -31.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3536 -31.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3566 -32.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0778 -32.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7872 -32.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6444 -32.9916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9277 -32.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
5 6 2 0
4 7 1 0
3 8 1 0
8 9 3 0
2 10 2 0
7 11 1 0
7 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
17 22 1 0
5 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.88Molecular Weight (Monoisotopic): 421.1193AlogP: 4.17#Rotatable Bonds: 4Polar Surface Area: 69.71Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.40CX LogP: 3.82CX LogD: 3.82Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.85
References 1. Mishra S, Parmar N, Chandrakar P, Sharma CP, Parveen S, Vats RP, Seth A, Goel A, Kar S.. (2021) Design, synthesis, in vitro and in vivo biological evaluation of pyranone-piperazine analogs as potent antileishmanial agents., 221 [PMID:33992928 ] [10.1016/j.ejmech.2021.113516 ]