The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-methoxy-19-(R)-hydroxygelselegine ID: ALA4873355
PubChem CID: 11090753
Max Phase: Preclinical
Molecular Formula: C21H28N2O6
Molecular Weight: 404.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)N(OC)C(=O)[C@@]21C[C@@H]2N[C@](CO)([C@@H](C)O)[C@@H]3C[C@H]1OC[C@H]23
Standard InChI: InChI=1S/C21H28N2O6/c1-11(25)21(10-24)15-7-18-20(8-16(22-21)13(15)9-29-18)14-5-4-12(27-2)6-17(14)23(28-3)19(20)26/h4-6,11,13,15-16,18,22,24-25H,7-10H2,1-3H3/t11-,13+,15-,16+,18-,20+,21-/m1/s1
Standard InChI Key: GWYGPYIOBSALOZ-DMLIBQJSSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
9.9814 -18.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2386 -17.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2375 -18.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0418 -16.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8333 -15.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7808 -15.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9557 -15.4281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6344 -17.7288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3715 -17.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2349 -16.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0579 -17.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4314 -16.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9933 -15.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1679 -15.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7965 -16.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2417 -17.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5084 -18.5467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7332 -18.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1077 -17.7306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4656 -17.5063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.9554 -16.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2450 -16.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4211 -17.5361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5705 -16.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8557 -17.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2404 -15.8746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6943 -15.8838 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.3908 -16.6092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4918 -18.9027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9804 -18.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9363 -16.5378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5431 -17.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7271 -17.6166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
21 6 1 0
6 7 1 0
10 5 1 6
10 12 1 0
11 8 1 0
8 9 1 0
9 10 1 0
4 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 17 1 0
17 18 1 0
9 19 2 0
4 20 1 1
21 22 1 0
22 23 1 0
23 2 1 0
2 24 1 0
24 21 1 0
24 25 1 0
25 4 1 0
22 26 1 6
21 27 1 6
24 28 1 1
3 29 1 0
1 30 1 0
15 31 1 0
31 32 1 0
1 33 1 6
7 4 1 0
5 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.46Molecular Weight (Monoisotopic): 404.1947AlogP: 0.35#Rotatable Bonds: 4Polar Surface Area: 100.49Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.30CX LogP: -0.35CX LogD: -3.09Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: 1.93
References 1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G.. (2021) Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems., 84 (4.0): [PMID:33826318 ] [10.1021/acs.jnatprod.1c00062 ]