11-methoxy-19-(R)-hydroxygelselegine

ID: ALA4873355

PubChem CID: 11090753

Max Phase: Preclinical

Molecular Formula: C21H28N2O6

Molecular Weight: 404.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)N(OC)C(=O)[C@@]21C[C@@H]2N[C@](CO)([C@@H](C)O)[C@@H]3C[C@H]1OC[C@H]23

Standard InChI:  InChI=1S/C21H28N2O6/c1-11(25)21(10-24)15-7-18-20(8-16(22-21)13(15)9-29-18)14-5-4-12(27-2)6-17(14)23(28-3)19(20)26/h4-6,11,13,15-16,18,22,24-25H,7-10H2,1-3H3/t11-,13+,15-,16+,18-,20+,21-/m1/s1

Standard InChI Key:  GWYGPYIOBSALOZ-DMLIBQJSSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    9.9814  -18.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2386  -17.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2375  -18.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0418  -16.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8333  -15.9699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7808  -15.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9557  -15.4281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6344  -17.7288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3715  -17.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2349  -16.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0579  -17.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4314  -16.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9933  -15.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1679  -15.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7965  -16.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417  -17.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5084  -18.5467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7332  -18.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1077  -17.7306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4656  -17.5063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9554  -16.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2450  -16.7315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4211  -17.5361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5705  -16.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8557  -17.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2404  -15.8746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6943  -15.8838    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3908  -16.6092    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4918  -18.9027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9804  -18.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9363  -16.5378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5431  -17.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7271  -17.6166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
 21  6  1  0
  6  7  1  0
 10  5  1  6
 10 12  1  0
 11  8  1  0
  8  9  1  0
  9 10  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  1  0
 17 18  1  0
  9 19  2  0
  4 20  1  1
 21 22  1  0
 22 23  1  0
 23  2  1  0
  2 24  1  0
 24 21  1  0
 24 25  1  0
 25  4  1  0
 22 26  1  6
 21 27  1  6
 24 28  1  1
  3 29  1  0
  1 30  1  0
 15 31  1  0
 31 32  1  0
  1 33  1  6
  7  4  1  0
  5 22  1  0
M  END

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.46Molecular Weight (Monoisotopic): 404.1947AlogP: 0.35#Rotatable Bonds: 4
Polar Surface Area: 100.49Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.30CX LogP: -0.35CX LogD: -3.09
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: 1.93

References

1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G..  (2021)  Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems.,  84  (4.0): [PMID:33826318] [10.1021/acs.jnatprod.1c00062]

Source