The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(4-(((2-(4-cholobenzylidene)-3-oxo-2,3-dihydrobenzofuran-6-yl)oxy)methyl)-2,6-dimethylphenoxy)-2-methylpropanoic acid ID: ALA4873389
PubChem CID: 164620412
Max Phase: Preclinical
Molecular Formula: C28H25ClO6
Molecular Weight: 492.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc3c(c2)O/C(=C\c2ccc(Cl)cc2)C3=O)cc(C)c1OC(C)(C)C(=O)O
Standard InChI: InChI=1S/C28H25ClO6/c1-16-11-19(12-17(2)26(16)35-28(3,4)27(31)32)15-33-21-9-10-22-23(14-21)34-24(25(22)30)13-18-5-7-20(29)8-6-18/h5-14H,15H2,1-4H3,(H,31,32)/b24-13-
Standard InChI Key: MYJCFXHKNKIJEJ-CFRMEGHHSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
21.7650 -11.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4720 -11.1514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1804 -11.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1200 -11.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7156 -10.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3066 -11.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8875 -11.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5945 -11.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3011 -11.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3003 -10.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5869 -9.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8833 -10.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5828 -9.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0092 -11.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0068 -9.9203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4222 -9.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1311 -10.3227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4198 -9.0990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0587 -11.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0663 -12.7836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7700 -12.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3530 -12.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3545 -11.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5778 -11.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0962 -11.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5754 -12.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3214 -13.4040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2790 -11.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8717 -11.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2850 -10.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8784 -9.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0603 -9.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6506 -10.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0595 -11.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6520 -9.1320 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
5 4 1 0
6 5 1 0
3 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
9 14 1 0
10 15 1 0
15 5 1 0
5 16 1 0
16 17 1 0
16 18 2 0
1 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 1 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
26 27 2 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.96Molecular Weight (Monoisotopic): 492.1340AlogP: 6.39#Rotatable Bonds: 7Polar Surface Area: 82.06Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.71CX Basic pKa: ┄CX LogP: 6.72CX LogD: 3.42Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.33
References 1. Liu K, Zhao X, Qi X, Hou DL, Li HB, Gu YH, Xu QL.. (2021) Design, synthesis, and biological evaluation of a novel dual peroxisome proliferator-activated receptor alpha/delta agonist for the treatment of diabetic kidney disease through anti-inflammatory mechanisms., 218 [PMID:33784603 ] [10.1016/j.ejmech.2021.113388 ]