The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3,6-Dihydro-2H-pyran-4-yl)-N-(6'-((4-isopropylpiperazin-1-yl)methyl)-[3,3'-bipyridin]-5-yl)-2-methoxypyridine-3-sulfonamide ID: ALA4873390
PubChem CID: 164620413
Max Phase: Preclinical
Molecular Formula: C29H36N6O4S
Molecular Weight: 564.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(C2=CCOCC2)cc1S(=O)(=O)Nc1cncc(-c2ccc(CN3CCN(C(C)C)CC3)nc2)c1
Standard InChI: InChI=1S/C29H36N6O4S/c1-21(2)35-10-8-34(9-11-35)20-26-5-4-23(17-31-26)24-14-27(19-30-16-24)33-40(36,37)28-15-25(18-32-29(28)38-3)22-6-12-39-13-7-22/h4-6,14-19,21,33H,7-13,20H2,1-3H3
Standard InChI Key: CLFPTIZZKYEKLN-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
12.6582 -17.2105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0709 -16.5048 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2534 -16.5002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3547 -15.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0682 -15.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7716 -15.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7636 -14.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0536 -14.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3481 -14.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7768 -16.9275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6492 -15.7020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9392 -15.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7462 -19.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0416 -18.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0546 -18.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7680 -17.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4684 -18.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4555 -18.9808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3194 -20.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3282 -19.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6278 -18.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9144 -19.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9014 -20.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6019 -20.5765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1880 -20.5552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4876 -20.1360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5005 -19.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7960 -18.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0826 -19.3017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0696 -20.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7742 -20.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3821 -18.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3909 -18.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6687 -19.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1680 -12.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4625 -13.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4669 -14.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1805 -14.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8860 -14.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8779 -13.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
2 10 1 0
5 2 1 0
11 12 1 0
4 11 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
14 20 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
32 33 1 0
32 34 1 0
29 32 1 0
25 26 1 0
23 25 1 0
10 16 1 0
35 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 1 0
35 40 1 0
7 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.71Molecular Weight (Monoisotopic): 564.2519AlogP: 3.68#Rotatable Bonds: 9Polar Surface Area: 109.78Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.06CX Basic pKa: 8.13CX LogP: 0.92CX LogD: 0.83Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.42Np Likeness Score: -1.36
References 1. Down K, Amour A, Anderson NA, Barton N, Campos S, Cannons EP, Clissold C, Convery MA, Coward JJ, Doyle K, Duempelfeld B, Edwards CD, Goldsmith MD, Krause J, Mallett DN, McGonagle GA, Patel VK, Rowedder J, Rowland P, Sharpe A, Sriskantharajah S, Thomas DA, Thomson DW, Uddin S, Hamblin JN, Hessel EM.. (2021) Discovery of GSK251: A Highly Potent, Highly Selective, Orally Bioavailable Inhibitor of PI3Kδ with a Novel Binding Mode., 64 (18.0): [PMID:34510892 ] [10.1021/acs.jmedchem.1c01102 ]