Ent-4-amino-16-alpha-hydroxy-19-norbeyeran-15-beta-methyl-4-methoxybenzoate

ID: ALA4873429

PubChem CID: 164622060

Max Phase: Preclinical

Molecular Formula: C28H41NO4

Molecular Weight: 455.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)OC[C@@H]2[C@@H](O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(N)[C@H]5CC[C@@]24C3)cc1

Standard InChI:  InChI=1S/C28H41NO4/c1-25-14-10-22-26(2)12-5-13-27(3,29)21(26)11-15-28(22,17-25)20(23(25)30)16-33-24(31)18-6-8-19(32-4)9-7-18/h6-9,20-23,30H,5,10-17,29H2,1-4H3/t20-,21+,22+,23-,25+,26-,27-,28-/m1/s1

Standard InChI Key:  NKOPSLINRGPJDL-JVDMJLNVSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   10.6561  -25.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2439  -25.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0706  -25.8345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9448  -23.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9448  -24.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6561  -23.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3673  -23.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3662  -24.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0724  -25.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7910  -24.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0790  -23.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7923  -23.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5096  -23.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5234  -22.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8101  -22.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0873  -22.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6511  -24.2999    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0721  -24.3000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.2422  -22.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3602  -23.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5026  -24.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2341  -23.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0318  -22.8661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8895  -25.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7327  -25.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1299  -25.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9731  -25.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6839  -26.5226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3642  -26.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2065  -26.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6535  -25.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2520  -25.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4107  -25.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4987  -25.9219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8935  -26.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  4  6  1  0
  5  1  1  0
  1  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  1  0
  8 17  1  1
 11 18  1  1
 14 19  1  1
  7 20  1  6
 12 21  1  0
 14 22  1  0
 21 22  1  0
 22 23  1  6
 21 24  1  1
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 27  1  0
 31 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4873429

    ---

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.64Molecular Weight (Monoisotopic): 455.3036AlogP: 4.95#Rotatable Bonds: 4
Polar Surface Area: 81.78Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.72CX LogP: 4.33CX LogD: 1.48
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: 1.50

References

1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y..  (2021)  Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents.,  219  [PMID:33862515] [10.1016/j.ejmech.2021.113396]

Source