The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl 4-((2-methoxyethyl)(6-(5-(methylsulfonyl)-2,3-dihydro-1H-indol-1-yl)pyrimidin-4-yl)amino)piperidine-1-carboxylate ID: ALA4873459
PubChem CID: 164622064
Max Phase: Preclinical
Molecular Formula: C26H37N5O5S
Molecular Weight: 531.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN(c1cc(N2CCc3cc(S(C)(=O)=O)ccc32)ncn1)C1CCN(C(=O)OC(C)(C)C)CC1
Standard InChI: InChI=1S/C26H37N5O5S/c1-26(2,3)36-25(32)29-11-9-20(10-12-29)30(14-15-35-4)23-17-24(28-18-27-23)31-13-8-19-16-21(37(5,33)34)6-7-22(19)31/h6-7,16-18,20H,8-15H2,1-5H3
Standard InChI Key: HTYWQJMNYWMUKO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
24.4412 -13.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4454 -14.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1577 -13.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9747 -11.1831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3913 -11.8998 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8037 -11.1806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1066 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1055 -13.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5338 -12.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8184 -11.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5367 -13.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8192 -13.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9893 -14.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8120 -14.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1502 -13.6942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9575 -13.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5045 -14.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3112 -13.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5686 -13.1844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0132 -12.5686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2086 -12.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8615 -14.5838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6689 -14.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2176 -15.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0220 -14.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2832 -14.0851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7337 -13.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9230 -13.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0913 -13.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6393 -14.5356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3514 -13.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6777 -12.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9953 -14.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6044 -15.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7970 -15.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5399 -16.3208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7325 -16.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 12 1 0
11 9 1 0
9 10 2 0
10 7 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
29 31 2 0
7 5 1 0
5 32 1 0
30 2 1 0
2 33 1 0
22 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.68Molecular Weight (Monoisotopic): 531.2515AlogP: 3.43#Rotatable Bonds: 7Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.77CX LogP: 2.77CX LogD: 2.76Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -1.60
References 1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K.. (2021) Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives., 41 [PMID:34010766 ] [10.1016/j.bmc.2021.116208 ]