4-((E)-7'-Methoxy-2,2,2',2'-tetramethyl-2,3,2',3'-tetrahydro-[4,4']bichromenyliden-7-yloxy)-1-pyrrolidin-1-yl-butan-1-one

ID: ALA4873486

PubChem CID: 164622074

Max Phase: Preclinical

Molecular Formula: C31H39NO5

Molecular Weight: 505.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OCCCC(=O)N3CCCC3)ccc21

Standard InChI:  InChI=1S/C31H39NO5/c1-30(2)19-25(23-12-10-21(34-5)17-27(23)36-30)26-20-31(3,4)37-28-18-22(11-13-24(26)28)35-16-8-9-29(33)32-14-6-7-15-32/h10-13,17-18H,6-9,14-16,19-20H2,1-5H3/b26-25+

Standard InChI Key:  CZDJHOFPKMVAJT-OCEACIFDSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    3.0114   -2.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8368   -2.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4255   -1.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0932   -5.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2679   -5.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6785   -6.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4085   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4074   -5.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1231   -5.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1213   -4.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8376   -4.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8364   -5.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5504   -5.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2711   -4.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5527   -4.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -5.8586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9765   -5.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5527   -3.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5582   -1.7272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8372   -2.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2717   -2.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2695   -2.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9722   -3.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6817   -2.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6800   -2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9726   -1.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3943   -1.7276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1107   -2.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8252   -1.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5416   -2.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2560   -1.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9724   -2.1297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2540   -0.8953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0600   -2.9486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8676   -3.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2766   -2.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7215   -1.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 15  1  0
 12 13  1  0
 13  5  1  0
  5 14  1  0
 14 15  1  0
  8 16  1  0
 16 17  1  0
 15 18  2  0
 18 22  1  0
 18 20  1  0
 21 19  1  0
 19  2  1  0
  2 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4873486

    ---

Associated Targets(Human)

PA-1 (704 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 505.66Molecular Weight (Monoisotopic): 505.2828AlogP: 6.51#Rotatable Bonds: 6
Polar Surface Area: 57.23Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.16

References

1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A..  (2021)  Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog.,  50  [PMID:34469711] [10.1016/j.bmcl.2021.128340]

Source