The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyano-1-(6-((4-((3-ethynylphenyl)amino)-7-methoxyquinazolin-6-yl)oxy)hexyl)-3-(pyridin-3-yl)guanidine ID: ALA4873506
PubChem CID: 147735525
Max Phase: Preclinical
Molecular Formula: C30H30N8O2
Molecular Weight: 534.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCCCN/C(=N\C#N)Nc4cccnc4)cc23)c1
Standard InChI: InChI=1S/C30H30N8O2/c1-3-22-10-8-11-23(16-22)37-29-25-17-28(27(39-2)18-26(25)35-21-36-29)40-15-7-5-4-6-14-33-30(34-20-31)38-24-12-9-13-32-19-24/h1,8-13,16-19,21H,4-7,14-15H2,2H3,(H2,33,34,38)(H,35,36,37)
Standard InChI Key: GZHCSTJUZKGLGS-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
30.2924 -6.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2913 -7.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9993 -7.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7090 -7.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7062 -6.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9976 -6.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4135 -7.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1218 -8.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5798 -7.8913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5795 -8.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5770 -10.3413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2872 -9.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2843 -9.1135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8689 -9.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8717 -9.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1706 -8.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4663 -9.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4675 -9.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1691 -10.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7568 -10.3387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7610 -8.7045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7534 -11.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0511 -9.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3456 -8.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6357 -9.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9302 -8.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2203 -9.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5148 -8.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8049 -9.0855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0994 -8.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3895 -9.0776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1040 -7.8558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8140 -7.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5256 -7.0437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6840 -8.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6926 -7.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9880 -7.4364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2771 -7.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2752 -8.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9803 -9.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 3 0
4 7 1 0
2 9 1 0
9 10 1 0
10 15 1 0
14 11 1 0
11 12 2 0
12 13 1 0
13 10 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 2 0
18 20 1 0
17 21 1 0
20 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
32 33 1 0
33 34 3 0
31 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.62Molecular Weight (Monoisotopic): 534.2492AlogP: 5.24#Rotatable Bonds: 12Polar Surface Area: 129.37Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.04CX LogP: 4.80CX LogD: 4.80Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: -1.29
References 1. Zhang W, Zhang K, Yao Y, Liu Y, Ni Y, Liao C, Tu Z, Qiu Y, Wang D, Chen D, Qiang L, Li Z, Jiang S.. (2021) Dual nicotinamide phosphoribosyltransferase and epidermal growth factor receptor inhibitors for the treatment of cancer., 211 [PMID:33239261 ] [10.1016/j.ejmech.2020.113022 ]