The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-cyanobenzyl)-N-((R)-1-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-4-yl)-1H-imidazole-4-carboxamide ID: ALA4873547
PubChem CID: 156826324
Max Phase: Preclinical
Molecular Formula: C24H25N7O
Molecular Weight: 427.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cnc2c1CC[C@H]2NC(=O)c1cn(Cc2ccc(N3CC4CC4C3)cc2C#N)cn1
Standard InChI: InChI=1S/C24H25N7O/c1-29-13-27-23-20(4-5-22(23)29)28-24(32)21-12-30(14-26-21)9-15-2-3-19(7-16(15)8-25)31-10-17-6-18(17)11-31/h2-3,7,12-14,17-18,20H,4-6,9-11H2,1H3,(H,28,32)/t17?,18?,20-/m1/s1
Standard InChI Key: KZLVQSNMHFYIJD-AFMYVXGZSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
17.9230 -8.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9219 -9.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6366 -9.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3531 -9.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3502 -8.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6348 -8.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2056 -9.7404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4522 -9.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1187 -10.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3117 -10.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8970 -10.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4823 -10.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6324 -7.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0631 -8.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7791 -8.4907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8721 -9.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6797 -9.4782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0895 -8.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5352 -8.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9096 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3971 -9.3383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2423 -7.9178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2173 -9.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7733 -9.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5257 -9.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6286 -8.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4326 -8.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8384 -7.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2850 -7.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5375 -7.7137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6582 -7.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6257 -6.4412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 11 1 0
10 9 1 0
9 7 1 0
2 7 1 0
11 10 1 0
12 11 1 0
10 12 1 0
6 13 1 0
5 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 15 1 0
18 20 1 0
20 21 1 0
20 22 2 0
23 21 1 1
23 24 1 0
24 25 1 0
25 27 1 0
26 23 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 26 1 0
28 31 1 0
13 32 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.51Molecular Weight (Monoisotopic): 427.2121AlogP: 2.41#Rotatable Bonds: 5Polar Surface Area: 91.77Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.59CX LogP: 1.83CX LogD: 1.82Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.68Np Likeness Score: -1.14
References 1. Sabnis RW.. (2021) Novel Heteroaromatic Carboxamide Derivatives as Plasma Kallikrein Inhibitors for Treating Diabetic Complications, Ocular Diseases and Edema-Associated Diseases., 12 (12.0): [PMID:34917251 ] [10.1021/acsmedchemlett.1c00622 ]