1-(4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-cyanobenzyl)-N-((R)-1-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-4-yl)-1H-imidazole-4-carboxamide

ID: ALA4873547

PubChem CID: 156826324

Max Phase: Preclinical

Molecular Formula: C24H25N7O

Molecular Weight: 427.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cnc2c1CC[C@H]2NC(=O)c1cn(Cc2ccc(N3CC4CC4C3)cc2C#N)cn1

Standard InChI:  InChI=1S/C24H25N7O/c1-29-13-27-23-20(4-5-22(23)29)28-24(32)21-12-30(14-26-21)9-15-2-3-19(7-16(15)8-25)31-10-17-6-18(17)11-31/h2-3,7,12-14,17-18,20H,4-6,9-11H2,1H3,(H,28,32)/t17?,18?,20-/m1/s1

Standard InChI Key:  KZLVQSNMHFYIJD-AFMYVXGZSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   17.9230   -8.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9219   -9.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6366   -9.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3531   -9.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3502   -8.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6348   -8.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2056   -9.7404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4522   -9.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1187  -10.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3117  -10.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8970  -10.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4823  -10.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6324   -7.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0631   -8.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7791   -8.4907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8721   -9.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6797   -9.4782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0895   -8.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5352   -8.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9096   -8.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3971   -9.3383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2423   -7.9178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2173   -9.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7733   -9.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5257   -9.5178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6286   -8.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4326   -8.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8384   -7.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2850   -7.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5375   -7.7137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6582   -7.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6257   -6.4412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8 11  1  0
 10  9  1  0
  9  7  1  0
  2  7  1  0
 11 10  1  0
 12 11  1  0
 10 12  1  0
  6 13  1  0
  5 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 18 20  1  0
 20 21  1  0
 20 22  2  0
 23 21  1  1
 23 24  1  0
 24 25  1  0
 25 27  1  0
 26 23  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 28 31  1  0
 13 32  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4873547

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.51Molecular Weight (Monoisotopic): 427.2121AlogP: 2.41#Rotatable Bonds: 5
Polar Surface Area: 91.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.59CX LogP: 1.83CX LogD: 1.82
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.68Np Likeness Score: -1.14

References

1. Sabnis RW..  (2021)  Novel Heteroaromatic Carboxamide Derivatives as Plasma Kallikrein Inhibitors for Treating Diabetic Complications, Ocular Diseases and Edema-Associated Diseases.,  12  (12.0): [PMID:34917251] [10.1021/acsmedchemlett.1c00622]

Source