The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-N-demethylkoumine ID: ALA4873560
PubChem CID: 164622089
Max Phase: Preclinical
Molecular Formula: C19H20N2O
Molecular Weight: 292.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@@]12CN[C@@H]3C[C@]14C(=Nc1ccccc14)[C@H]1C[C@@H]2[C@@H]3CO1
Standard InChI: InChI=1S/C19H20N2O/c1-2-18-10-20-15-8-19(18)12-5-3-4-6-14(12)21-17(19)16-7-13(18)11(15)9-22-16/h2-6,11,13,15-16,20H,1,7-10H2/t11-,13+,15+,16+,18-,19-/m0/s1
Standard InChI Key: CVAPBADJBVUJQA-ALRJNDEISA-N
Molfile:
RDKit 2D
26 31 0 0 0 0 0 0 0 0999 V2000
7.3374 -32.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0475 -32.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3374 -30.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0455 -31.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7629 -30.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7743 -30.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0617 -29.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3422 -30.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6230 -32.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6180 -31.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8365 -32.4765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3438 -31.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8311 -31.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4932 -30.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6771 -30.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1913 -30.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5276 -31.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6140 -30.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4919 -29.7591 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.7591 -31.8053 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6109 -29.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4094 -31.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1970 -31.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2184 -32.8420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3291 -33.5168 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.5590 -30.7774 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10 3 1 0
9 1 1 0
1 2 1 0
2 4 1 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 1 0
10 13 1 0
12 11 1 0
11 9 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
3 18 1 6
6 19 1 6
4 20 1 6
18 21 2 0
10 22 1 1
22 6 1 0
5 23 1 0
1 24 1 0
24 23 1 0
1 25 1 6
5 26 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 292.38Molecular Weight (Monoisotopic): 292.1576AlogP: 2.59#Rotatable Bonds: 1Polar Surface Area: 33.62Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.78CX LogP: 2.34CX LogD: 0.01Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.81Np Likeness Score: 2.35
References 1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G.. (2021) Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems., 84 (4.0): [PMID:33826318 ] [10.1021/acs.jnatprod.1c00062 ]