ethyl 4-(3-methyl-3-(pyridin-4-ylmethyl)ureido)benzoate

ID: ALA4873588

PubChem CID: 40143935

Max Phase: Preclinical

Molecular Formula: C17H19N3O3

Molecular Weight: 313.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(NC(=O)N(C)Cc2ccncc2)cc1

Standard InChI:  InChI=1S/C17H19N3O3/c1-3-23-16(21)14-4-6-15(7-5-14)19-17(22)20(2)12-13-8-10-18-11-9-13/h4-11H,3,12H2,1-2H3,(H,19,22)

Standard InChI Key:  NVLXEJHFLFTLHY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    6.6580   -9.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3632  -10.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0689   -9.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0663   -8.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3520   -8.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6493   -8.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7719   -8.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4817   -8.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1873   -8.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8971   -8.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7677   -7.6771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9523  -10.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2426   -9.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2384   -8.9174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5369  -10.1468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8272   -9.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7073  -10.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7061  -10.9725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4142  -11.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1238  -10.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1210  -10.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4124   -9.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5411  -10.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  1 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 16  1  0
 15 23  1  0
M  END

Associated Targets(Human)

NAMPT Tchem Nicotinamide phosphoribosyltransferase (3221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 313.36Molecular Weight (Monoisotopic): 313.1426AlogP: 2.92#Rotatable Bonds: 5
Polar Surface Area: 71.53Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.64CX Basic pKa: 5.02CX LogP: 2.19CX LogD: 2.19
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.86Np Likeness Score: -1.64

References

1. Pinkerton AB, Sessions EH, Hershberger P, Maloney PR, Peddibhotla S, Hopf M, Sergienko E, Ma CT, Smith LH, Jackson MR, Tanaka J, Tsuji T, Akiu M, Cohen SE, Nakamura T, Gardell SJ..  (2021)  Optimization of a urea-containing series of nicotinamide phosphoribosyltransferase (NAMPT) activators.,  41  [PMID:33798699] [10.1016/j.bmcl.2021.128007]

Source