The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3aR,5s,6aS)-2-((tetrahydro-2H-pyran-4-yl)methyl-d2)-N-(6-(2,3,5-trifluorophenyl)pyridazin-3-yl)octahydrocyclopenta[c]pyrrol-5-amine ID: ALA4873617
PubChem CID: 164620747
Max Phase: Preclinical
Molecular Formula: C23H27F3N4O
Molecular Weight: 432.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])(C1CCOCC1)N1C[C@H]2C[C@H](Nc3ccc(-c4cc(F)cc(F)c4F)nn3)C[C@H]2C1
Standard InChI: InChI=1S/C23H27F3N4O/c24-17-9-19(23(26)20(25)10-17)21-1-2-22(29-28-21)27-18-7-15-12-30(13-16(15)8-18)11-14-3-5-31-6-4-14/h1-2,9-10,14-16,18H,3-8,11-13H2,(H,27,29)/t15-,16+,18+/i11D2
Standard InChI Key: ITSKPCHXUYILTR-VRBVDISKSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
36.7200 -24.0948 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.3155 -23.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9065 -24.0922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.5896 -21.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5885 -22.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2965 -22.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0062 -22.5736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0033 -21.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2947 -21.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7095 -21.3397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4187 -21.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8823 -22.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1746 -22.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4671 -22.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4660 -23.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1784 -24.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8830 -23.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5109 -22.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1676 -21.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7168 -22.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3148 -22.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8658 -23.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6084 -22.9882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5162 -22.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0238 -22.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7334 -23.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4355 -22.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4329 -22.1549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7219 -21.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0136 -22.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9011 -23.4303 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
35.1186 -21.3006 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.5915 -24.2035 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1806 -25.0232 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.7599 -22.5694 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
11 10 1 6
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 12 1 0
11 18 1 0
18 21 1 0
20 19 1 0
19 11 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
23 2 1 0
2 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
21 31 1 6
20 32 1 6
17 33 1 0
16 34 1 0
14 35 1 0
M ISO 2 1 2 3 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.49Molecular Weight (Monoisotopic): 432.2137AlogP: 4.11#Rotatable Bonds: 5Polar Surface Area: 50.28Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.83CX LogP: 3.16CX LogD: 0.00Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.72Np Likeness Score: -1.33
References 1. Spock M, Carter TR, Bollinger KA, Han C, Baker LA, Rodriguez AL, Peng L, Dickerson JW, Qi A, Rook JM, O'Neill JC, Watson KJ, Chang S, Bridges TM, Engers JL, Engers DW, Niswender CM, Conn PJ, Lindsley CW, Bender AM.. (2021) Discovery of VU6028418: A Highly Selective and Orally Bioavailable M4 Muscarinic Acetylcholine Receptor Antagonist., 12 (8.0): [PMID:34413964 ] [10.1021/acsmedchemlett.1c00363 ]