The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(2,2-difluoropropoxy)pyrimidin-5-yl)methylamino)-4-((1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl)amino)pyrimidine-5-carbonitrile ID: ALA4873647
Cas Number: 1799574-70-1
PubChem CID: 118162109
Product Number: C608350, Order Now?
Max Phase: Preclinical
Molecular Formula: C21H27F2N7O2
Molecular Weight: 447.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(F)(F)COc1ncncc1CNc1ncc(C#N)c(N[C@@H]2CC[C@H](O)C(C)(C)C2)n1
Standard InChI: InChI=1S/C21H27F2N7O2/c1-20(2)6-15(4-5-16(20)31)29-17-13(7-24)9-26-19(30-17)27-10-14-8-25-12-28-18(14)32-11-21(3,22)23/h8-9,12,15-16,31H,4-6,10-11H2,1-3H3,(H2,26,27,29,30)/t15-,16+/m1/s1
Standard InChI Key: FMKGJQHNYMWDFJ-CVEARBPZSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
16.3430 -4.3107 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.9349 -5.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7593 -5.0223 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.5121 -1.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9285 -2.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3406 -1.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7849 -5.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7853 -5.0329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5011 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2165 -5.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2161 -5.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5002 -6.2703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9323 -4.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6439 -4.2098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5015 -3.7963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0733 -6.2696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0729 -7.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9297 -8.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9301 -7.5054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6459 -7.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3571 -7.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3566 -8.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6451 -8.7427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6474 -6.2688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9340 -5.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2160 -3.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9292 -3.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6415 -3.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6461 -2.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2139 -2.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3621 -2.1611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2220 -4.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
13 14 3 0
10 13 1 0
9 15 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
17 21 1 0
16 17 1 0
7 16 1 0
20 24 1 0
24 25 1 0
25 2 1 0
26 15 1 1
26 27 1 0
26 30 1 0
27 28 1 0
28 29 1 0
29 5 1 0
5 30 1 0
29 31 1 1
2 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.2194AlogP: 3.14#Rotatable Bonds: 8Polar Surface Area: 128.87Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.51CX LogP: 2.23CX LogD: 2.23Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -0.78
References 1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE.. (2021) Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005., 64 (16.0): [PMID:34355886 ] [10.1021/acs.jmedchem.1c00388 ]