The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-7-(2-fluorophenyl)-1-(2-isopropyl-4-methylpyridin-3-yl)-4-(methyl(1-(oxirane-2-carbonyl)azetidin-3-yl)amino)pyrido[2,3-d]pyrimidin-2(1H)-one ID: ALA4873683
PubChem CID: 164620787
Max Phase: Preclinical
Molecular Formula: C29H28ClFN6O3
Molecular Weight: 563.03
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccnc(C(C)C)c1-n1c(=O)nc(N(C)C2CN(C(=O)C3CO3)C2)c2cc(Cl)c(-c3ccccc3F)nc21
Standard InChI: InChI=1S/C29H28ClFN6O3/c1-15(2)23-25(16(3)9-10-32-23)37-27-19(11-20(30)24(33-27)18-7-5-6-8-21(18)31)26(34-29(37)39)35(4)17-12-36(13-17)28(38)22-14-40-22/h5-11,15,17,22H,12-14H2,1-4H3
Standard InChI Key: NGAWGYKFZKABRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
7.1830 -19.9648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8993 -19.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8965 -18.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1811 -18.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4681 -19.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4722 -18.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7617 -18.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0425 -18.7174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0384 -19.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7534 -19.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3215 -19.9530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6094 -18.3058 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6109 -19.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6108 -20.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3251 -21.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0399 -20.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0360 -19.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3212 -19.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3175 -18.7241 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7514 -20.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0339 -21.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0305 -22.0199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7440 -22.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4623 -22.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4621 -21.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2333 -20.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0220 -20.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6483 -21.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1770 -20.7869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7697 -17.4838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4882 -17.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0593 -17.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8508 -16.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0520 -16.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2577 -17.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3415 -16.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3494 -15.2302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6231 -16.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7961 -16.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2016 -17.1740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
3 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 20 1 0
21 26 1 0
26 27 1 0
26 28 1 0
25 29 1 0
7 30 1 0
30 31 1 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 32 1 0
34 36 1 0
36 37 2 0
36 38 1 0
39 38 1 0
40 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.03Molecular Weight (Monoisotopic): 562.1895AlogP: 4.11#Rotatable Bonds: 6Polar Surface Area: 96.75Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.74CX LogP: 4.25CX LogD: 4.25Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -0.99