The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)-4-methyl-3-((4-(thiophen-2-yl)pyrimidin-2-yl)amino)-benzamide ID: ALA4873838
PubChem CID: 164621254
Max Phase: Preclinical
Molecular Formula: C29H31N5O3S
Molecular Weight: 529.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCNC(=O)c1ccc(C)c(Nc3nccc(-c4cccs4)n3)c1)CC2
Standard InChI: InChI=1S/C29H31N5O3S/c1-19-6-7-21(15-24(19)33-29-31-10-8-23(32-29)27-5-4-14-38-27)28(35)30-11-13-34-12-9-20-16-25(36-2)26(37-3)17-22(20)18-34/h4-8,10,14-17H,9,11-13,18H2,1-3H3,(H,30,35)(H,31,32,33)
Standard InChI Key: ZBHYVGXHFABTBU-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.8694 -25.5269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8683 -26.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5805 -26.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2942 -26.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2914 -25.5233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5787 -25.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5762 -24.2926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2868 -23.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9937 -24.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7038 -23.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7018 -23.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9838 -22.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2807 -23.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5659 -22.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4166 -24.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4187 -25.1088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1228 -23.8763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8386 -24.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5448 -23.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2582 -24.2780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2566 -25.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9659 -25.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9636 -23.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6774 -24.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6770 -25.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3878 -25.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0995 -25.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0960 -24.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3846 -23.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8059 -23.8534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8124 -25.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5191 -25.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5155 -24.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0041 -26.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0898 -27.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8892 -27.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2976 -27.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7505 -26.4284 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
10 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 23 1 0
21 22 1 0
22 25 1 0
24 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
27 31 1 0
31 32 1 0
30 33 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 34 1 0
4 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.67Molecular Weight (Monoisotopic): 529.2148AlogP: 5.06#Rotatable Bonds: 9Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.35CX Basic pKa: 6.78CX LogP: 5.03CX LogD: 4.94Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.68
References 1. Qiu Q, Zou F, Li H, Shi W, Zhou D, Zhang P, Li T, Yin Z, Cai Z, Jiang Y, Huang W, Qian H.. (2021) Structure-Based Discovery of Pyrimidine Aminobenzene Derivatives as Potent Oral Reversal Agents against P-gp- and BCRP-Mediated Multidrug Resistance., 64 (9.0): [PMID:33938746 ] [10.1021/acs.jmedchem.1c00246 ]