(S)-cyclobutyl(3-(9-ethyl-8-(2-methylpyrimidin-5-yl)-9H-purin-6-yloxy)pyrrolidin-1-yl)methanone

ID: ALA4873843

PubChem CID: 164619876

Max Phase: Preclinical

Molecular Formula: C21H25N7O2

Molecular Weight: 407.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c(-c2cnc(C)nc2)nc2c(O[C@H]3CCN(C(=O)C4CCC4)C3)ncnc21

Standard InChI:  InChI=1S/C21H25N7O2/c1-3-28-18(15-9-22-13(2)23-10-15)26-17-19(28)24-12-25-20(17)30-16-7-8-27(11-16)21(29)14-5-4-6-14/h9-10,12,14,16H,3-8,11H2,1-2H3/t16-/m0/s1

Standard InChI Key:  AATSAMRSGNEIGC-INIZCTEOSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   40.3602  -14.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3560  -13.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.0617  -13.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8061  -13.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3498  -13.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9376  -12.3750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1392  -12.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2661  -11.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0784  -11.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7824  -10.9682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.3663  -16.2265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0743  -15.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0670  -14.9948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6560  -15.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6504  -15.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8742  -14.7601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4001  -15.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8833  -16.0775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5830  -15.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6362  -16.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1716  -14.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3965  -14.6782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9512  -15.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3695  -16.1459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1845  -16.1366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1341  -15.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8380  -17.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7129  -12.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2240  -11.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5862  -10.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  6  8  1  0
  8  9  1  0
  8 10  2  0
  1 15  2  0
 14 11  2  0
 11 12  1  0
 12 13  2  0
 13  1  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 17 19  1  0
 18 20  1  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 23 26  1  0
 20 27  1  0
  9 28  1  0
 28 29  1  0
 29 30  1  0
 30  9  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4873843

    ---

Associated Targets(Human)

PIK3R1 Tchem PI3-kinase p110-delta/p85-alpha (1508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CD Tclin PI3-kinase p110-delta subunit (6699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.48Molecular Weight (Monoisotopic): 407.2070AlogP: 2.39#Rotatable Bonds: 5
Polar Surface Area: 98.92Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.27CX LogP: 1.70CX LogD: 1.70
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.36

References

1. Methot JL, Zhou H, McGowan MA, Anthony NJ, Christopher M, Garcia Y, Achab A, Lipford K, Trotter BW, Altman MD, Fradera X, Lesburg CA, Li C, Alves S, Chappell CP, Jain R, Mangado R, Pinheiro E, Williams SMG, Goldenblatt P, Hill A, Shaffer L, Chen D, Tong V, McLeod RL, Lee HH, Yu H, Shah S, Katz JD..  (2021)  Projected Dose Optimization of Amino- and Hydroxypyrrolidine Purine PI3Kδ Immunomodulators.,  64  (8.0): [PMID:33797901] [10.1021/acs.jmedchem.1c00237]

Source