5-((4-(tert-Butyl)phenyl)sulfonyl)-2-(2-methoxy-5-methylphenyl)-1H-imidazole

ID: ALA4873927

PubChem CID: 130471911

Max Phase: Preclinical

Molecular Formula: C21H24N2O3S

Molecular Weight: 384.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C)cc1-c1ncc(S(=O)(=O)c2ccc(C(C)(C)C)cc2)[nH]1

Standard InChI:  InChI=1S/C21H24N2O3S/c1-14-6-11-18(26-5)17(12-14)20-22-13-19(23-20)27(24,25)16-9-7-15(8-10-16)21(2,3)4/h6-13H,1-5H3,(H,22,23)

Standard InChI Key:  GTMOGLDGMYWKBV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   44.5328  -21.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8229  -20.7682    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.8219  -21.5878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5704  -19.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5693  -20.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2815  -20.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9953  -20.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9924  -19.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2797  -18.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7037  -20.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7905  -21.3154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5942  -21.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0017  -20.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4497  -20.1652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.2813  -21.3239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5693  -21.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2327  -20.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0546  -20.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4603  -19.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0487  -18.6357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2232  -18.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8171  -19.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4535  -17.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2748  -17.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0410  -17.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8618  -17.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2773  -18.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 13  2  1  0
  2 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
  9 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4873927

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.50Molecular Weight (Monoisotopic): 384.1508AlogP: 4.52#Rotatable Bonds: 4
Polar Surface Area: 72.05Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.07CX Basic pKa: 3.19CX LogP: 4.82CX LogD: 4.03
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -0.92

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source