The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5,7-dimethoxy-4-morpholinoquinazolin-2-yl)-N-hydroxybenzamide ID: ALA4873932
PubChem CID: 164626283
Max Phase: Preclinical
Molecular Formula: C21H22N4O5
Molecular Weight: 410.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c2c(N3CCOCC3)nc(-c3ccc(C(=O)NO)cc3)nc2c1
Standard InChI: InChI=1S/C21H22N4O5/c1-28-15-11-16-18(17(12-15)29-2)20(25-7-9-30-10-8-25)23-19(22-16)13-3-5-14(6-4-13)21(26)24-27/h3-6,11-12,27H,7-10H2,1-2H3,(H,24,26)
Standard InChI Key: DCSQFOSWPCQGPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.2409 -20.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2397 -21.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9478 -21.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9460 -19.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6546 -20.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6554 -21.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3639 -21.5243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0722 -21.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0674 -20.2913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3583 -19.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7815 -21.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7797 -22.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4882 -22.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1953 -22.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1895 -21.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4805 -21.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9051 -22.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9094 -23.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6107 -22.3205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3205 -22.7254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3540 -19.0708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0639 -18.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0615 -17.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3535 -17.4393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6461 -17.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9436 -19.0758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6500 -18.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2346 -18.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5317 -21.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1757 -21.1202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
10 21 1 0
21 22 1 0
21 27 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 27 1 0
4 26 1 0
26 28 1 0
2 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.43Molecular Weight (Monoisotopic): 410.1590AlogP: 2.27#Rotatable Bonds: 5Polar Surface Area: 106.04Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.97CX Basic pKa: 5.90CX LogP: 2.58CX LogD: 2.56Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.13
References 1. Yao D, Jiang J, Zhang H, Huang Y, Huang J, Wang J.. (2021) Design, synthesis and biological evaluation of dual mTOR/HDAC6 inhibitors in MDA-MB-231 cells., 47 [PMID:34139324 ] [10.1016/j.bmcl.2021.128204 ]