The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-7-(2-fluorophenyl)-4-((S)-4-((2R,3S)-3-(hydroxymethyl)oxirane-2-carbonyl)-2-methylpiperazin-1-yl)-1-(2-isopropyl-4-methylpyridin-3-yl)pyrido[2,3-d]pyrimidin-2(1H)-one ID: ALA4873951
PubChem CID: 156296149
Max Phase: Preclinical
Molecular Formula: C31H32ClFN6O4
Molecular Weight: 607.09
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccnc(C(C)C)c1-n1c(=O)nc(N2CCN(C(=O)[C@@H]3O[C@H]3CO)C[C@@H]2C)c2cc(Cl)c(-c3ccccc3F)nc21
Standard InChI: InChI=1S/C31H32ClFN6O4/c1-16(2)24-26(17(3)9-10-34-24)39-29-20(13-21(32)25(35-29)19-7-5-6-8-22(19)33)28(36-31(39)42)38-12-11-37(14-18(38)4)30(41)27-23(15-40)43-27/h5-10,13,16,18,23,27,40H,11-12,14-15H2,1-4H3/t18-,23-,27+/m0/s1
Standard InChI Key: UPNPGIBFJWOTFY-IKKGAQDJSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
13.7753 -9.3614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4918 -8.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4890 -8.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7736 -7.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0605 -8.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0647 -8.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3541 -7.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6349 -8.1140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6307 -8.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3458 -9.3610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9137 -9.3496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2019 -7.7024 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.2034 -9.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2034 -10.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9177 -10.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6325 -10.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6286 -9.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9137 -8.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9101 -8.1206 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.3438 -10.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6262 -10.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6228 -11.4168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3363 -11.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0548 -11.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0546 -10.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8255 -10.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6143 -9.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2404 -10.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7694 -10.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3621 -6.8802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0810 -6.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0883 -5.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3783 -5.2312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6593 -5.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6504 -6.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9329 -6.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3867 -4.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1053 -4.0010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6765 -3.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2729 -3.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8531 -3.9781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2820 -2.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5721 -2.0225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
3 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 20 1 0
21 26 1 0
26 27 1 0
26 28 1 0
25 29 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
7 30 1 0
35 36 1 1
33 37 1 0
37 38 2 0
39 37 1 6
40 39 1 0
41 40 1 0
39 41 1 0
40 42 1 1
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.09Molecular Weight (Monoisotopic): 606.2158AlogP: 3.86#Rotatable Bonds: 6Polar Surface Area: 116.98Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.74CX LogP: 3.98CX LogD: 3.98Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.33Np Likeness Score: -0.74