(1R,5S,6r)-3-(cyclopentanecarbonyl)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-3-azabicyclo[3.1.0]hexane-6-carboxamide

ID: ALA4874070

PubChem CID: 164628818

Max Phase: Preclinical

Molecular Formula: C22H28N6O2

Molecular Weight: 408.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1CCN(c2nccn3ccnc23)C1)[C@H]1[C@@H]2CN(C(=O)C3CCCC3)C[C@@H]21

Standard InChI:  InChI=1S/C22H28N6O2/c29-21(18-16-12-28(13-17(16)18)22(30)14-3-1-2-4-14)25-15-5-8-27(11-15)20-19-23-6-9-26(19)10-7-24-20/h6-7,9-10,14-18H,1-5,8,11-13H2,(H,25,29)/t15-,16-,17+,18+/m0/s1

Standard InChI Key:  WWNOWOWILQUYCR-WNRNVDISSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   31.9736  -12.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7908  -12.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0452  -11.3532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3822  -10.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7235  -11.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8136  -11.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4165  -11.6519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1912  -11.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3664  -10.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7605  -10.0551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9794  -10.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7623   -9.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9908   -8.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5123   -9.6466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9462  -11.1011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3391  -11.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5618  -11.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5094  -12.4474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7632  -11.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0161  -10.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3537  -10.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6915  -10.7918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9447  -11.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5922  -10.2066    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.9731  -12.3569    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.9143  -10.5394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7442   -9.7401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3071  -11.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5077  -10.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0993  -11.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6463  -12.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3927  -11.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874070

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.51Molecular Weight (Monoisotopic): 408.2274AlogP: 1.32#Rotatable Bonds: 4
Polar Surface Area: 82.84Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -0.03CX LogD: -0.03
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.83Np Likeness Score: -1.36

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source