The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-16-oxo-15-beta-((3,4,5-trimethoxybenzoyl)oxy)methylbeyeran-19-oic acid ID: ALA4874122
PubChem CID: 164626750
Max Phase: Preclinical
Molecular Formula: C31H42O8
Molecular Weight: 542.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)OC[C@@H]2C(=O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)cc(OC)c1OC
Standard InChI: InChI=1S/C31H42O8/c1-28-12-8-23-29(2)10-7-11-30(3,27(34)35)22(29)9-13-31(23,17-28)19(25(28)32)16-39-26(33)18-14-20(36-4)24(38-6)21(15-18)37-5/h14-15,19,22-23H,7-13,16-17H2,1-6H3,(H,34,35)/t19-,22+,23+,28+,29-,30-,31-/m1/s1
Standard InChI Key: LEGVAKWIVKEGNR-NTXRIGQESA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
21.6716 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2720 -13.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0768 -13.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9787 -11.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9787 -12.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6716 -11.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3686 -11.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3652 -12.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0548 -13.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7566 -12.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0618 -11.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7601 -11.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4596 -11.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4712 -10.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7770 -10.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0671 -10.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6731 -14.5111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8816 -13.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6597 -12.3115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.0547 -12.3157 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.1716 -10.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3613 -11.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4497 -12.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1637 -11.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9460 -10.9158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8291 -13.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6335 -13.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0096 -13.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8139 -13.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5854 -14.4529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1918 -14.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9953 -14.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4244 -13.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0399 -13.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2375 -13.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2313 -13.8806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6055 -14.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4621 -12.4533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2665 -12.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3717 -15.2457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9404 -15.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
3 17 1 0
3 18 2 0
8 19 1 1
11 20 1 1
14 21 1 1
7 22 1 6
12 23 1 0
14 24 1 0
23 24 1 0
24 25 2 0
23 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
33 36 1 0
36 37 1 0
34 38 1 0
38 39 1 0
32 40 1 0
40 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.67Molecular Weight (Monoisotopic): 542.2880AlogP: 5.55#Rotatable Bonds: 7Polar Surface Area: 108.36Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.50CX Basic pKa: ┄CX LogP: 5.79CX LogD: 2.98Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.45Np Likeness Score: 1.63
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]