3-(5-(4-(4-(4-methyl-2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)pentyl)-1H-indole-5-carbonitrile

ID: ALA4874141

PubChem CID: 118190933

Max Phase: Preclinical

Molecular Formula: C30H33N5O

Molecular Weight: 479.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccn(-c2ccc(N3CCN(CCCCCc4c[nH]c5ccc(C#N)cc45)CC3)cc2)c(=O)c1

Standard InChI:  InChI=1S/C30H33N5O/c1-23-12-14-35(30(36)19-23)27-9-7-26(8-10-27)34-17-15-33(16-18-34)13-4-2-3-5-25-22-32-29-11-6-24(21-31)20-28(25)29/h6-12,14,19-20,22,32H,2-5,13,15-18H2,1H3

Standard InChI Key:  JIQDQLNNYZEFOF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    5.8288  -18.8288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5828  -18.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4980  -17.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6925  -17.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2802  -16.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4557  -16.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0435  -17.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4557  -18.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2802  -18.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0435  -16.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6311  -15.3593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1099  -17.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8941  -17.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5061  -16.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2902  -17.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9063  -16.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6863  -16.7822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8585  -17.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6428  -17.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2589  -17.2920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0866  -16.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3024  -16.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0389  -17.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2112  -18.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9954  -18.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6115  -18.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4391  -17.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6550  -16.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0033  -17.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7918  -18.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9639  -18.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3479  -19.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5637  -19.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3915  -18.3114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8353  -16.9530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7482  -19.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  1  0
 29 35  2  0
 26 34  1  0
 20 23  1  0
 16 17  1  0
  3 12  1  0
 31 36  1  0
M  END

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.63Molecular Weight (Monoisotopic): 479.2685AlogP: 5.03#Rotatable Bonds: 8
Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.48CX LogP: 5.40CX LogD: 4.29
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.16

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source