The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,5-dimethoxyphenylcarbamoyl)naphthalen-2-yl 5-chloro-2-methoxyphenylcarbamate ID: ALA4874261
PubChem CID: 427011
Max Phase: Preclinical
Molecular Formula: C27H23ClN2O6
Molecular Weight: 506.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(NC(=O)c2cc3ccccc3cc2OC(=O)Nc2cc(Cl)ccc2OC)c1
Standard InChI: InChI=1S/C27H23ClN2O6/c1-33-19-9-11-24(35-3)22(15-19)29-26(31)20-12-16-6-4-5-7-17(16)13-25(20)36-27(32)30-21-14-18(28)8-10-23(21)34-2/h4-15H,1-3H3,(H,29,31)(H,30,32)
Standard InChI Key: OBQXUGIKVLVKAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
35.9880 -4.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9869 -5.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6949 -5.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4046 -5.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4017 -4.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6931 -4.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2802 -4.2636 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
38.1129 -5.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1142 -6.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1079 -4.2571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8172 -4.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5233 -4.2518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8202 -5.4802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2326 -4.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2325 -5.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6424 -4.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9334 -4.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6481 -5.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9404 -5.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9426 -6.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6518 -7.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3602 -6.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3545 -5.8717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9267 -3.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6310 -3.0132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2156 -3.0249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6242 -2.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3312 -1.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3248 -0.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6132 -0.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9066 -0.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9164 -1.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2137 -2.2155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5011 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0293 -0.5541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7402 -0.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
4 8 1 0
8 9 1 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
17 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
33 34 1 0
29 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.94Molecular Weight (Monoisotopic): 506.1245AlogP: 6.38#Rotatable Bonds: 7Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.01CX Basic pKa: ┄CX LogP: 5.70CX LogD: 5.70Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -0.97
References 1. Almahmoud S, Elix CC, Jones JO, Hopkins CR, Vennerstrom JL, Zhong HA.. (2021) Virtual screening and biological evaluation of PPARγ antagonists as potential anti-prostate cancer agents., 46 [PMID:34433102 ] [10.1016/j.bmc.2021.116368 ]