3-(2,5-dimethoxyphenylcarbamoyl)naphthalen-2-yl 5-chloro-2-methoxyphenylcarbamate

ID: ALA4874261

PubChem CID: 427011

Max Phase: Preclinical

Molecular Formula: C27H23ClN2O6

Molecular Weight: 506.94

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(OC)c(NC(=O)c2cc3ccccc3cc2OC(=O)Nc2cc(Cl)ccc2OC)c1

Standard InChI:  InChI=1S/C27H23ClN2O6/c1-33-19-9-11-24(35-3)22(15-19)29-26(31)20-12-16-6-4-5-7-17(16)13-25(20)36-27(32)30-21-14-18(28)8-10-23(21)34-2/h4-15H,1-3H3,(H,29,31)(H,30,32)

Standard InChI Key:  OBQXUGIKVLVKAT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   35.9880   -4.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9869   -5.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6949   -5.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4046   -5.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4017   -4.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6931   -4.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2802   -4.2636    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.1129   -5.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1142   -6.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1079   -4.2571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8172   -4.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5233   -4.2518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8202   -5.4802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.2326   -4.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2325   -5.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6424   -4.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9334   -4.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6481   -5.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9404   -5.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9426   -6.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6518   -7.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3602   -6.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3545   -5.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9267   -3.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6310   -3.0132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.2156   -3.0249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6242   -2.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3312   -1.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3248   -0.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6132   -0.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9066   -0.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9164   -1.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2137   -2.2155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5011   -1.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0293   -0.5541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7402   -0.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  1  0
  8  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
 17 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 32 33  1  0
 33 34  1  0
 29 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.94Molecular Weight (Monoisotopic): 506.1245AlogP: 6.38#Rotatable Bonds: 7
Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.01CX Basic pKa: CX LogP: 5.70CX LogD: 5.70
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -0.97

References

1. Almahmoud S, Elix CC, Jones JO, Hopkins CR, Vennerstrom JL, Zhong HA..  (2021)  Virtual screening and biological evaluation of PPARγ antagonists as potential anti-prostate cancer agents.,  46  [PMID:34433102] [10.1016/j.bmc.2021.116368]

Source