The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(1-(2-((4-methyl-3-(trifluoromethyl)phenyl)amino)-2-oxoethyl)-1H-1,2,3-triazol-4-yl)-1H-indazol-3-yl)cyclopropanecarboxamide ID: ALA4874268
PubChem CID: 164628441
Max Phase: Preclinical
Molecular Formula: C23H20F3N7O2
Molecular Weight: 483.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2cc(-c3ccc4c(NC(=O)C5CC5)n[nH]c4c3)nn2)cc1C(F)(F)F
Standard InChI: InChI=1S/C23H20F3N7O2/c1-12-2-6-15(9-17(12)23(24,25)26)27-20(34)11-33-10-19(30-32-33)14-5-7-16-18(8-14)29-31-21(16)28-22(35)13-3-4-13/h2,5-10,13H,3-4,11H2,1H3,(H,27,34)(H2,28,29,31,35)
Standard InChI Key: ULYAZMWFIQWLFU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
36.4803 -7.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1900 -7.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1871 -6.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4785 -6.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7723 -7.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7735 -6.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9973 -6.1879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5163 -6.8478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9953 -7.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7416 -8.2859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8933 -6.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6389 -6.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1834 -5.7454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7721 -5.0392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9735 -5.2122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9964 -5.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3316 -6.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1446 -6.6554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8538 -7.2360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.4798 -7.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9985 -8.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3331 -8.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1469 -8.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6251 -8.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2879 -7.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8549 -9.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0419 -9.3864 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1898 -10.2146 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.2694 -10.0457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.2876 -8.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0339 -9.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0871 -8.7253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4831 -9.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4279 -10.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2047 -10.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
10 30 1 0
30 31 1 0
30 32 2 0
23 33 1 0
34 31 1 0
35 34 1 0
31 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.45Molecular Weight (Monoisotopic): 483.1631AlogP: 4.14#Rotatable Bonds: 6Polar Surface Area: 117.59Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.05CX Basic pKa: 0.76CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -2.13
References 1. Wang XR, Wang S, Li WB, Xu KY, Qiao XP, Jing XL, Wang ZX, Yang CJ, Chen SW.. (2021) Design, synthesis and biological evaluation of novel 2-(4-(1H-indazol-6-yl)-1H-pyrazol-1-yl)acetamide derivatives as potent VEGFR-2 inhibitors., 213 [PMID:33493829 ] [10.1016/j.ejmech.2021.113192 ]