5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-((4-((tetrahydrofuran-2-yl)methyl)piperazin-1-yl)methyl)-4H-chromen-4-one

ID: ALA4874308

PubChem CID: 164625901

Max Phase: Preclinical

Molecular Formula: C25H28N2O6

Molecular Weight: 452.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1cc(-c2ccc(O)cc2)oc2c(CN3CCN(CC4CCCO4)CC3)c(O)cc(O)c12

Standard InChI:  InChI=1S/C25H28N2O6/c28-17-5-3-16(4-6-17)23-13-22(31)24-21(30)12-20(29)19(25(24)33-23)15-27-9-7-26(8-10-27)14-18-2-1-11-32-18/h3-6,12-13,18,28-30H,1-2,7-11,14-15H2

Standard InChI Key:  OOEABJDNSYFTIF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    5.2087  -12.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2075  -13.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9215  -13.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9196  -12.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6341  -12.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6329  -13.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3489  -13.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0706  -13.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0718  -12.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3513  -12.2214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4950  -12.2306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9212  -14.7050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3466  -14.7095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9171  -11.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024  -10.9964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2026  -10.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4918   -9.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7770  -10.1697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7775  -10.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4928  -11.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0638   -9.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7847  -12.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4975  -12.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2116  -12.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2141  -11.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4965  -11.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7854  -11.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9282  -11.0030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3525  -10.9936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3475  -10.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5600   -9.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0783  -10.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5681  -11.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 11  1  0
  3 12  1  0
  7 13  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 30  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  9 22  1  0
 25 28  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874308

    ---

Associated Targets(Human)

PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1947AlogP: 2.87#Rotatable Bonds: 5
Polar Surface Area: 106.61Molecular Species: ACIDHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.72CX Basic pKa: 6.89CX LogP: 1.80CX LogD: 1.39
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: 0.38

References

1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H..  (2021)  Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer.,  64  (16.0): [PMID:34404206] [10.1021/acs.jmedchem.1c00735]

Source