The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1H-imidazole-1-yl)-3-phenoxypropan-2-yl (4-chlorophenyl)carbamate ID: ALA4874326
PubChem CID: 164626114
Max Phase: Preclinical
Molecular Formula: C19H18ClN3O3
Molecular Weight: 371.82
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Cl)cc1)OC(COc1ccccc1)Cn1ccnc1
Standard InChI: InChI=1S/C19H18ClN3O3/c20-15-6-8-16(9-7-15)22-19(24)26-18(12-23-11-10-21-14-23)13-25-17-4-2-1-3-5-17/h1-11,14,18H,12-13H2,(H,22,24)
Standard InChI Key: KKAQFXMPPDANDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
26.3963 -7.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3952 -7.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1032 -8.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8129 -7.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8101 -7.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1014 -6.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6837 -8.2338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9780 -7.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2683 -8.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5626 -7.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2645 -9.0443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8529 -8.2204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1090 -7.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5593 -8.4885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9646 -9.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7646 -9.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9703 -9.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9664 -10.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6801 -9.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3840 -9.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3751 -10.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0781 -10.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7906 -10.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7955 -9.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0919 -9.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4926 -10.7153 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 12 1 0
11 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.82Molecular Weight (Monoisotopic): 371.1037AlogP: 4.23#Rotatable Bonds: 7Polar Surface Area: 65.38Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.01CX Basic pKa: 6.77CX LogP: 4.05CX LogD: 3.98Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -1.34
References 1. Ammazzalorso A, Gallorini M, Fantacuzzi M, Gambacorta N, De Filippis B, Giampietro L, Maccallini C, Nicolotti O, Cataldi A, Amoroso R.. (2021) Design, synthesis and biological evaluation of imidazole and triazole-based carbamates as novel aromatase inhibitors., 211 [PMID:33360796 ] [10.1016/j.ejmech.2020.113115 ]