3-(3-(4-(4-(1-oxoisoquinolin-2(1H)-yl)phenyl)piperazin-1-yl)propyl)-1H-indole-5-carbonitrile

ID: ALA4874384

PubChem CID: 118190899

Max Phase: Preclinical

Molecular Formula: C31H29N5O

Molecular Weight: 487.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCCN3CCN(c4ccc(-n5ccc6ccccc6c5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C31H29N5O/c32-21-23-7-12-30-29(20-23)25(22-33-30)5-3-14-34-16-18-35(19-17-34)26-8-10-27(11-9-26)36-15-13-24-4-1-2-6-28(24)31(36)37/h1-2,4,6-13,15,20,22,33H,3,5,14,16-19H2

Standard InChI Key:  HPAQZIMCOCMLHZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    8.9324  -20.3342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5389  -19.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2086  -19.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3941  -19.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876  -18.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0104  -18.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8397  -19.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4461  -20.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2234  -19.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4039  -18.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7975  -17.7384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6172  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4344  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8430  -17.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6602  -17.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0688  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8860  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2946  -17.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8860  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0688  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1118  -17.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5204  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3376  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7462  -17.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3376  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5204  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9720  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5634  -17.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9720  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7892  -18.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1977  -17.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0149  -17.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4235  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0149  -16.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1977  -16.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7892  -16.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5634  -16.2069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 27 36  1  0
 31 36  2  0
 27 37  2  0
 24 28  1  0
 18 21  1  0
 14 15  1  0
  3 12  1  0
M  END

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.61Molecular Weight (Monoisotopic): 487.2372AlogP: 5.10#Rotatable Bonds: 6
Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.58CX LogP: 5.57CX LogD: 4.37
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.27

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source