The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(2-Butylbenzofuran-3-carbonyl)phenoxy)-1-(piperidin-1-yl)-butan-1-one ID: ALA4874389
PubChem CID: 164626961
Max Phase: Preclinical
Molecular Formula: C28H33NO4
Molecular Weight: 447.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1oc2ccccc2c1C(=O)c1ccc(OCCCC(=O)N2CCCCC2)cc1
Standard InChI: InChI=1S/C28H33NO4/c1-2-3-11-25-27(23-10-5-6-12-24(23)33-25)28(31)21-14-16-22(17-15-21)32-20-9-13-26(30)29-18-7-4-8-19-29/h5-6,10,12,14-17H,2-4,7-9,11,13,18-20H2,1H3
Standard InChI Key: FXITUARNFZMFHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
29.0899 -30.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0887 -31.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8036 -31.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8018 -29.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5171 -30.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5174 -31.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3079 -31.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7962 -30.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3074 -30.0807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6212 -30.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0334 -30.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8584 -30.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2706 -29.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5630 -32.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0111 -32.8231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3700 -32.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6225 -33.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4288 -33.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9816 -32.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7225 -31.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9170 -31.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7888 -32.8934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3398 -32.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1471 -32.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6982 -31.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5054 -32.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7615 -32.7901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0564 -31.3919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8629 -31.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4130 -30.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1607 -30.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3530 -29.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7975 -30.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
7 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.2410AlogP: 6.18#Rotatable Bonds: 10Polar Surface Area: 59.75Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.54CX LogD: 5.54Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.46
References 1. Zhang J, Zou L, Shi D, Liu J, Zhang J, Zhao R, Wang G, Zhang L, Ouyang L, Liu B.. (2021) Structure-Guided Design of a Small-Molecule Activator of Sirtuin-3 that Modulates Autophagy in Triple Negative Breast Cancer., 64 (19.0): [PMID:34605238 ] [10.1021/acs.jmedchem.0c02268 ]