6-(1H-indol-3-yl)-1-((tetrahydrofuran-2-yl)methyl)-1H-benzotriazole

ID: ALA4874421

PubChem CID: 164627174

Max Phase: Preclinical

Molecular Formula: C19H18N4O

Molecular Weight: 318.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc2c(-c3ccc4c(c3)nnn4CC3CCCO3)c[nH]c2c1

Standard InChI:  InChI=1S/C19H18N4O/c1-2-6-17-15(5-1)16(11-20-17)13-7-8-19-18(10-13)21-22-23(19)12-14-4-3-9-24-14/h1-2,5-8,10-11,14,20H,3-4,9,12H2

Standard InChI Key:  CFYFZTUTGVRVPN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 28  0  0  0  0  0  0  0  0999 V2000
    2.6111  -12.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6100  -13.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3180  -14.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3162  -12.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0248  -12.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0296  -13.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8097  -13.9816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2870  -13.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8019  -12.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0499  -11.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8500  -11.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7456  -10.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5012  -11.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5500  -10.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0952  -10.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8397  -10.5972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7547   -9.7867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9576   -9.6172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6254   -8.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1059   -8.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9211   -8.2092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1738   -7.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5127   -6.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8516   -7.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874421

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.38Molecular Weight (Monoisotopic): 318.1481AlogP: 3.76#Rotatable Bonds: 3
Polar Surface Area: 55.73Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.30CX LogP: 3.59CX LogD: 3.59
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.06

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source