N-(2-Fluorophenyl)-4-(2-((4-methoxybenzyl)amino)-2-oxoethoxy)benzamide

ID: ALA4874432

PubChem CID: 164627371

Max Phase: Preclinical

Molecular Formula: C23H21FN2O4

Molecular Weight: 408.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)COc2ccc(C(=O)Nc3ccccc3F)cc2)cc1

Standard InChI:  InChI=1S/C23H21FN2O4/c1-29-18-10-6-16(7-11-18)14-25-22(27)15-30-19-12-8-17(9-13-19)23(28)26-21-5-3-2-4-20(21)24/h2-13H,14-15H2,1H3,(H,25,27)(H,26,28)

Standard InChI Key:  RVFSNTGBCPCQNT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   15.4892   -9.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1989   -9.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1989   -8.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4874   -7.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7824   -8.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7824   -9.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0749   -7.9058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0749   -7.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9072   -9.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6143   -9.1332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3226   -9.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0297   -9.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7381   -9.5384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4451   -9.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1506   -9.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8564   -9.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8564   -8.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1431   -7.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4451   -8.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5629   -7.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5629   -7.0815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2718   -8.3052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9783   -7.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6843   -8.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3904   -7.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3904   -7.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6746   -6.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9783   -7.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6843   -9.1188    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.3226  -10.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 24 29  1  0
 11 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4874432

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.43Molecular Weight (Monoisotopic): 408.1485AlogP: 3.78#Rotatable Bonds: 8
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.26CX Basic pKa: CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.66

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source