(2S,3aR,9bR)-7,8-dihydroxy-2-propyl-6-((3-(trifluoromethyl)benzyl)oxy)-3,3a-dihydro-2H-furo[3,2-c]isochromen-5(9bH)-one

ID: ALA4874441

PubChem CID: 164627379

Max Phase: Preclinical

Molecular Formula: C22H21F3O6

Molecular Weight: 438.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC[C@H]1C[C@H]2OC(=O)c3c(cc(O)c(O)c3OCc3cccc(C(F)(F)F)c3)[C@H]2O1

Standard InChI:  InChI=1S/C22H21F3O6/c1-2-4-13-8-16-19(30-13)14-9-15(26)18(27)20(17(14)21(28)31-16)29-10-11-5-3-6-12(7-11)22(23,24)25/h3,5-7,9,13,16,19,26-27H,2,4,8,10H2,1H3/t13-,16+,19+/m0/s1

Standard InChI Key:  VXDPAPFCOAHDCI-URKNILKWSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   15.5230   -8.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5219   -9.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2367   -9.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2349   -8.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9503   -8.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9491   -9.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3818   -8.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6643   -8.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3807   -9.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6622   -9.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8312  -10.7647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6541  -10.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9936  -10.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6643   -7.4722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0911   -9.1247    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0745  -10.5372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.0639  -11.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8888  -11.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2986  -12.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2324   -7.4787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8085   -8.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8072   -9.9556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9457   -7.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9432   -6.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6583   -5.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6562   -5.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9399   -4.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2244   -5.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2300   -5.8355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3696   -4.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0851   -5.0012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.9494   -3.8707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.7744   -3.8707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
  8 14  2  0
  9 15  1  1
 10 16  1  1
 12 17  1  6
 17 18  1  0
 18 19  1  0
  4 20  1  0
  1 21  1  0
  2 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 26 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874441

    ---

Associated Targets(non-human)

Trypanosoma cruzi (99888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.40Molecular Weight (Monoisotopic): 438.1290AlogP: 4.86#Rotatable Bonds: 5
Polar Surface Area: 85.22Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 4.71CX LogD: 4.68
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: 1.11

References

1. Coronado L, Zhang XQ, Dorta D, Escala N, Pineda LM, Ng MG, Del Olmo E, Wang CY, Gu YC, Shao CL, Spadafora C..  (2021)  Semisynthesis, Antiplasmodial Activity, and Mechanism of Action Studies of Isocoumarin Derivatives.,  84  (5.0): [PMID:33979168] [10.1021/acs.jnatprod.0c01032]

Source