4-((2S)-2-(2-(3-chloro-2-fluorophenyl)-1-hydroxy-4-methyl-1H-imidazole-5-carboxamido)-3-phenylpropanamido)benzoic acid

ID: ALA4874449

PubChem CID: 164627586

Max Phase: Preclinical

Molecular Formula: C27H22ClFN4O5

Molecular Weight: 536.95

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(Cl)c2F)n(O)c1C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C27H22ClFN4O5/c1-15-23(33(38)24(30-15)19-8-5-9-20(28)22(19)29)26(35)32-21(14-16-6-3-2-4-7-16)25(34)31-18-12-10-17(11-13-18)27(36)37/h2-13,21,38H,14H2,1H3,(H,31,34)(H,32,35)(H,36,37)/t21-/m0/s1

Standard InChI Key:  KZNQTJNGFPKOOT-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    7.7674  -25.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4752  -24.8996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1829  -25.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1803  -26.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8872  -26.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5959  -26.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5933  -25.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8858  -24.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3041  -26.5339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3052  -27.3511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0113  -26.1244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0597  -24.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3520  -25.3082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6443  -24.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674  -26.1254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0597  -24.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674  -23.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4747  -24.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1819  -23.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1824  -22.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4697  -22.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7654  -22.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6443  -24.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9366  -25.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1887  -24.9801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6419  -25.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0505  -26.2952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498  -26.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4568  -26.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0166  -24.1813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8340  -25.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5024  -24.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6904  -24.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2092  -25.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5457  -26.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3567  -26.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0677  -26.7442    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.6911  -26.9091    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  0
  1 15  2  0
 12 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 23  2  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 28 29  1  0
 25 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 26 31  1  0
 35 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874449

    ---

Associated Targets(Human)

F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.95Molecular Weight (Monoisotopic): 536.1263AlogP: 4.57#Rotatable Bonds: 8
Polar Surface Area: 133.55Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.16CX Basic pKa: 2.37CX LogP: 3.76CX LogD: 0.81
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.02

References

1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S..  (2021)  Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment.,  220  [PMID:33894565] [10.1016/j.ejmech.2021.113437]

Source