The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-5-hydroxy-6-(1-hydroxyethyl)-2,7-dimethoxy-1,4-naphthalenedione ID: ALA4874510
Cas Number: 86108-17-0
PubChem CID: 158914
Max Phase: Preclinical
Molecular Formula: C14H14O6
Molecular Weight: 278.26
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC1=CC(=O)c2c(cc(OC)c(C(C)O)c2O)C1=O
Standard InChI: InChI=1S/C14H14O6/c1-6(15)11-9(19-2)4-7-12(14(11)18)8(16)5-10(20-3)13(7)17/h4-6,15,18H,1-3H3
Standard InChI Key: DUFFAWHPHNGPDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
20 21 0 0 0 0 0 0 0 0999 V2000
3.7173 -13.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7162 -14.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4306 -14.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4288 -12.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1438 -13.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1425 -14.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8590 -14.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5814 -14.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5826 -13.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8614 -12.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8567 -15.4277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2942 -14.6045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2919 -15.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4264 -12.1222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0018 -14.5978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2880 -14.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0032 -12.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2892 -13.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8615 -12.1135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0030 -12.1226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
8 12 1 0
12 13 1 0
4 14 1 0
2 15 1 0
15 16 1 0
1 17 1 0
17 18 1 0
10 19 2 0
17 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 278.26Molecular Weight (Monoisotopic): 278.0790AlogP: 1.36#Rotatable Bonds: 3Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.49CX Basic pKa: ┄CX LogP: 0.93CX LogD: 0.89Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.87Np Likeness Score: 1.88
References 1. Flores-Bocanegra L, Raja HA, Bacon JW, Maldonado AC, Burdette JE, Pearce CJ, Oberlies NH.. (2021) Cytotoxic Naphthoquinone Analogues, Including Heterodimers, and Their Structure Elucidation Using LR-HSQMBC NMR Experiments., 84 (3.0): [PMID:33006889 ] [10.1021/acs.jnatprod.0c00856 ]