The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(2-(1-(phenylsulfonyl)-1H-indol-4-yloxy)ethyl)-N4-(1,2,3,4-tetrahydroacridin-9-yl)butane-1,4-diamine ID: ALA4874513
PubChem CID: 164629021
Max Phase: Preclinical
Molecular Formula: C33H36N4O3S
Molecular Weight: 568.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccccc1)n1ccc2c(OCCNCCCCNc3c4c(nc5ccccc35)CCCC4)cccc21
Standard InChI: InChI=1S/C33H36N4O3S/c38-41(39,25-11-2-1-3-12-25)37-23-19-28-31(37)17-10-18-32(28)40-24-22-34-20-8-9-21-35-33-26-13-4-6-15-29(26)36-30-16-7-5-14-27(30)33/h1-4,6,10-13,15,17-19,23,34H,5,7-9,14,16,20-22,24H2,(H,35,36)
Standard InChI Key: RGVNNAMFFGOWSE-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
36.1090 -2.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8152 -2.2671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5244 -2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9404 -3.4819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2257 -2.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9328 -2.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6328 -2.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6269 -1.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9151 -1.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2181 -1.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2333 -3.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5221 -3.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8173 -3.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8174 -4.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5285 -5.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2396 -4.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0669 -5.7368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3611 -5.3283 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.3601 -6.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0336 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0325 -3.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4474 -2.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7387 -2.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4502 -3.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7434 -3.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9110 -4.7259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7215 -4.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0546 -4.0692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5639 -5.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3151 -4.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5170 -4.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9679 -4.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2224 -5.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0199 -5.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1535 -2.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8628 -2.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5689 -2.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2782 -2.6890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9843 -2.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6936 -2.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3998 -2.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 12 2 0
11 4 2 0
4 6 1 0
5 3 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
18 17 2 0
19 18 2 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
26 18 1 0
18 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
22 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.74Molecular Weight (Monoisotopic): 568.2508AlogP: 6.17#Rotatable Bonds: 12Polar Surface Area: 85.25Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.77CX LogP: 5.81CX LogD: 2.21Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.18Np Likeness Score: -1.00
References 1. Wichur T, Pasieka A, Godyń J, Panek D, Góral I, Latacz G, Honkisz-Orzechowska E, Bucki A, Siwek A, Głuch-Lutwin M, Knez D, Brazzolotto X, Gobec S, Kołaczkowski M, Sabate R, Malawska B, Więckowska A.. (2021) Discovery of 1-(phenylsulfonyl)-1H-indole-based multifunctional ligands targeting cholinesterases and 5-HT6 receptor with anti-aggregation properties against amyloid-beta and tau., 225 [PMID:34461507 ] [10.1016/j.ejmech.2021.113783 ]