The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(5-((2-chlorophenyl)amino)-6-fluoro-1H-indazol-1-yl)-N-(tetrahydrofuran-3-yl)thiophene-2-carboxamide ID: ALA4874575
PubChem CID: 156155317
Max Phase: Preclinical
Molecular Formula: C22H18ClFN4O2S
Molecular Weight: 456.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H]1CCOC1)c1cc(-n2ncc3cc(Nc4ccccc4Cl)c(F)cc32)cs1
Standard InChI: InChI=1S/C22H18ClFN4O2S/c23-16-3-1-2-4-18(16)27-19-7-13-10-25-28(20(13)9-17(19)24)15-8-21(31-12-15)22(29)26-14-5-6-30-11-14/h1-4,7-10,12,14,27H,5-6,11H2,(H,26,29)/t14-/m0/s1
Standard InChI Key: FSGQLCRNDPQFNY-AWEZNQCLSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
2.4640 -21.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1717 -21.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7562 -21.4822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4640 -22.7080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7562 -20.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9203 -21.8156 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4672 -21.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0585 -20.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2593 -20.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3909 -19.7539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5257 -18.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9790 -19.0505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2691 -18.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1852 -19.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8485 -20.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5962 -19.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6766 -18.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0123 -18.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4207 -18.5759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5002 -17.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2440 -17.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3237 -16.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6587 -16.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9118 -16.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8356 -17.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9074 -17.9062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.2598 -20.2097 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4164 -20.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1639 -19.4026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3466 -19.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0942 -20.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
5 3 1 1
2 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 2 2 0
8 10 1 0
10 14 1 0
13 11 1 0
11 12 2 0
12 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
21 26 1 0
16 27 1 0
5 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.93Molecular Weight (Monoisotopic): 456.0823AlogP: 5.14#Rotatable Bonds: 5Polar Surface Area: 68.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.15CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.67
References 1. Feng Y, Park H, Ryu JC, Yoon SO.. (2021) N -Aromatic-Substituted Indazole Derivatives as Brain-Penetrant and Orally Bioavailable JNK3 Inhibitors., 12 (10.0): [PMID:34676036 ] [10.1021/acsmedchemlett.1c00334 ]