(1'R,6R)-Methyl spiro[penicillanate-6,1'-(2-benzoyl-5-benzyloxycarbonyl(cyclopent-4-enyl))]

ID: ALA4874585

PubChem CID: 164627884

Max Phase: Preclinical

Molecular Formula: C28H27NO6S

Molecular Weight: 505.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H]1N2C(=O)C3(C(C(=O)OCc4ccccc4)=CCC3C(=O)c3ccccc3)[C@H]2SC1(C)C

Standard InChI:  InChI=1S/C28H27NO6S/c1-27(2)22(24(32)34-3)29-25(33)28(26(29)36-27)19(21(30)18-12-8-5-9-13-18)14-15-20(28)23(31)35-16-17-10-6-4-7-11-17/h4-13,15,19,22,26H,14,16H2,1-3H3/t19?,22-,26+,28?/m0/s1

Standard InChI Key:  LUYLCGQSLWRTSX-JJMZWDMOSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    4.8570  -16.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6403  -15.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8125  -15.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5176  -16.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1631  -16.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6705  -16.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9581  -16.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6752  -16.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8622  -16.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6872  -16.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6918  -16.9243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4778  -17.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4704  -15.8402    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6789  -15.2703    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7376  -17.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1896  -18.5745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2789  -17.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1578  -14.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9729  -14.7793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8601  -13.8831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5749  -17.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7830  -17.9268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7795  -16.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5746  -16.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7801  -15.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1918  -16.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4036  -17.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1978  -17.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3776  -13.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0763  -12.4743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5932  -11.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2925  -11.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4774  -10.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9639  -11.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2673  -12.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5456  -18.1243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8056  -18.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  7  6  1  0
  7  8  1  0
  1  9  1  0
  9 11  1  0
 10  1  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
  7 13  1  0
 13 10  1  0
 10 14  1  6
 12 15  1  6
 15 16  2  0
  9 17  2  0
  2 18  1  0
 18 19  2  0
 18 20  1  0
  5 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 29  1  0
 30 29  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 15 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874585

    ---

Associated Targets(Human)

TZM (838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.59Molecular Weight (Monoisotopic): 505.1559AlogP: 3.78#Rotatable Bonds: 6
Polar Surface Area: 89.98Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: 0.48

References

1. Alves NG, Bártolo I, Alves AJS, Fontinha D, Francisco D, Lopes SMM, Soares MIL, Simões CJV, Prudêncio M, Taveira N, Pinho E Melo TMVD..  (2021)  Synthesis and structure-activity relationships of new chiral spiro-β-lactams highly active against HIV-1 and Plasmodium.,  219  [PMID:33887681] [10.1016/j.ejmech.2021.113439]

Source