The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Oregonin ID: ALA4874624
PubChem CID: 164628834
Max Phase: Preclinical
Molecular Formula: C24H30O10
Molecular Weight: 478.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCc1ccc(O)c(O)c1)C[C@H](CCc1ccc(O)c(O)c1)O[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1O
Standard InChI: InChI=1S/C24H30O10/c25-15(5-1-13-3-7-17(26)19(28)9-13)11-16(6-2-14-4-8-18(27)20(29)10-14)34-24-23(32)22(31)21(30)12-33-24/h3-4,7-10,16,21-24,26-32H,1-2,5-6,11-12H2/t16-,21-,22+,23-,24+/m0/s1
Standard InChI Key: AQRNEKDRSXYJIN-AAKLWPEZSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
16.3135 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3124 -8.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0204 -8.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7301 -8.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7272 -7.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0186 -6.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4334 -6.8903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4384 -8.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6043 -8.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6037 -9.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8957 -9.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8950 -10.5751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1883 -9.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4802 -9.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7729 -9.3477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4796 -10.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1870 -10.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1863 -11.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4760 -12.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4750 -13.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1830 -13.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8933 -13.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8908 -12.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1834 -14.2489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7668 -13.4295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0648 -9.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3610 -9.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6551 -9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6503 -10.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3575 -10.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0696 -10.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9407 -10.9726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7774 -10.9808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3540 -11.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0598 -8.9354 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
4 8 1 0
2 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 6
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
20 25 1 0
15 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
29 32 1 1
31 33 1 1
30 34 1 6
26 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.49Molecular Weight (Monoisotopic): 478.1839AlogP: 0.86#Rotatable Bonds: 10Polar Surface Area: 177.14Molecular Species: NEUTRALHBA: 10HBD: 7#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.08CX Basic pKa: ┄CX LogP: 1.97CX LogD: 1.96Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: 1.60
References 1. Masullo M, Lauro G, Cerulli A, Kontek B, Olas B, Bifulco G, Piacente S, Pizza C.. (2021) Giffonins, Antioxidant Diarylheptanoids from Corylus avellana , and Their Ability to Prevent Oxidative Changes in Human Plasma Proteins., 84 (3.0): [PMID:33616390 ] [10.1021/acs.jnatprod.0c01251 ]