4-(2-(6-cyanoquinazolin-4-ylamino)ethyl)-N,N-dimethylbenzamide

ID: ALA4874631

PubChem CID: 71679498

Max Phase: Preclinical

Molecular Formula: C20H19N5O

Molecular Weight: 345.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)c1ccc(CCNc2ncnc3ccc(C#N)cc23)cc1

Standard InChI:  InChI=1S/C20H19N5O/c1-25(2)20(26)16-6-3-14(4-7-16)9-10-22-19-17-11-15(12-21)5-8-18(17)23-13-24-19/h3-8,11,13H,9-10H2,1-2H3,(H,22,23,24)

Standard InChI Key:  JWWISQLEDZAXKH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.9194  -15.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9183  -16.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6263  -17.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6246  -15.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3332  -15.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3320  -16.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0382  -17.2026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7501  -16.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7513  -15.9749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0405  -15.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2122  -15.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5044  -15.1601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0406  -14.7441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7483  -14.3355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7483  -13.5183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4560  -13.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1607  -13.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8679  -13.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8684  -12.2964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1557  -11.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4514  -12.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5756  -11.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2838  -12.2945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5745  -11.0697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9910  -11.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2849  -13.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 26  1  0
M  END

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.41Molecular Weight (Monoisotopic): 345.1590AlogP: 2.86#Rotatable Bonds: 5
Polar Surface Area: 81.91Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 2.66CX LogD: 2.66
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: -1.63

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source