The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-3-([1,1'-biphenyl]-4-yl)-2-((S)-2-(4-aminobutanamido)-3-(5-hydroxy-1H-indol-3-yl)propanamido)propanamido)-6-aminohexanamide ID: ALA4874658
PubChem CID: 164625680
Max Phase: Preclinical
Molecular Formula: C36H45N7O5
Molecular Weight: 655.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC[C@H](NC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@H](Cc1c[nH]c2ccc(O)cc12)NC(=O)CCCN)C(N)=O
Standard InChI: InChI=1S/C36H45N7O5/c37-17-5-4-9-30(34(39)46)42-35(47)31(19-23-11-13-25(14-12-23)24-7-2-1-3-8-24)43-36(48)32(41-33(45)10-6-18-38)20-26-22-40-29-16-15-27(44)21-28(26)29/h1-3,7-8,11-16,21-22,30-32,40,44H,4-6,9-10,17-20,37-38H2,(H2,39,46)(H,41,45)(H,42,47)(H,43,48)/t30-,31-,32-/m0/s1
Standard InChI Key: UAQQDAYCKBFCNC-CPCREDONSA-N
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
21.0900 -16.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0889 -17.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8037 -17.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5201 -17.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5172 -16.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8018 -16.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2352 -17.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2317 -18.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9459 -19.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6607 -18.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6567 -17.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9419 -17.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3755 -16.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3752 -15.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6607 -14.9127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0896 -14.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8042 -15.3246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5185 -14.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2331 -15.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9475 -14.9116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2333 -16.1493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0894 -14.0873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9463 -15.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2318 -14.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9465 -16.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5174 -15.3257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8029 -14.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0885 -15.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8027 -14.0883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2316 -14.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9459 -13.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7019 -14.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2538 -13.4029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0342 -12.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8427 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0982 -11.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5463 -11.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7355 -11.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4838 -12.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5183 -14.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2328 -13.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2326 -12.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9469 -12.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9467 -11.6117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3740 -14.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6595 -15.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1817 -10.8553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9449 -14.9140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 13 1 0
14 13 1 6
14 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
16 22 2 0
15 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
24 30 1 1
30 31 1 0
31 32 2 0
32 33 1 0
33 35 1 0
34 31 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
18 40 1 1
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
28 45 1 0
45 46 1 0
38 47 1 0
46 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 655.80Molecular Weight (Monoisotopic): 655.3482AlogP: 2.13#Rotatable Bonds: 18Polar Surface Area: 218.45Molecular Species: BASEHBA: 7HBD: 8#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.47CX Basic pKa: 10.29CX LogP: 0.56CX LogD: -3.31Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.07Np Likeness Score: 0.10
References 1. Baggio C, Kulinich A, Dennys CN, Rodrigo R, Meyer K, Ethell I, Pellecchia M.. (2021) NMR-Guided Design of Potent and Selective EphA4 Agonistic Ligands., 64 (15.0): [PMID:34293864 ] [10.1021/acs.jmedchem.1c00608 ]