The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4874718
PubChem CID: 164626488
Max Phase: Preclinical
Molecular Formula: C32H44N2O5
Molecular Weight: 536.71
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCCCCNC(=O)CCCOc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OC)ccc21
Standard InChI: InChI=1S/C32H44N2O5/c1-31(2)20-26(24-13-11-22(36-6)18-28(24)38-31)27-21-32(3,4)39-29-19-23(12-14-25(27)29)37-17-9-10-30(35)34-16-8-7-15-33-5/h11-14,18-19,33H,7-10,15-17,20-21H2,1-6H3,(H,34,35)/b27-26+
Standard InChI Key: PZYNXYRIXUTBHB-CYYJNZCTSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
3.5494 -16.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3418 -16.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7633 -15.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5747 -19.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7575 -19.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1661 -20.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9289 -18.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9278 -19.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6358 -20.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6340 -18.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3426 -18.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3415 -19.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0477 -20.0545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7607 -18.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -18.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0498 -17.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0554 -15.9658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3422 -17.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7613 -16.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7591 -17.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4583 -17.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1602 -17.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1585 -16.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4587 -15.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2197 -20.0560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5124 -19.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8652 -15.9662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5739 -16.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2806 -15.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9893 -16.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6960 -15.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4047 -16.3663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6940 -15.1422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1114 -15.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8201 -16.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5268 -15.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2355 -16.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9422 -15.9491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6509 -16.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 5 1 0
5 14 1 0
14 15 1 0
16 20 1 0
16 18 1 0
19 17 1 0
17 2 1 0
2 18 1 0
15 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 25 1 0
25 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.71Molecular Weight (Monoisotopic): 536.3250AlogP: 6.00#Rotatable Bonds: 11Polar Surface Area: 78.05Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.24CX LogP: 4.36CX LogD: 1.66Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: 0.03
References 1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A.. (2021) Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog., 50 [PMID:34469711 ] [10.1016/j.bmcl.2021.128340 ]