2-(2-chloro-4-fluorophenyl)-N-((1-(3-chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)methyl)acetamide

ID: ALA4874740

PubChem CID: 164626773

Max Phase: Preclinical

Molecular Formula: C19H13Cl2F4N3O

Molecular Weight: 446.23

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(F)cc1Cl)NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1

Standard InChI:  InChI=1S/C19H13Cl2F4N3O/c20-12-2-1-3-14(7-12)28-15(9-17(27-28)19(23,24)25)10-26-18(29)6-11-4-5-13(22)8-16(11)21/h1-5,7-9H,6,10H2,(H,26,29)

Standard InChI Key:  PNMUACIEZIBFEG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    0.3282  -13.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1509  -14.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7614  -15.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5493  -14.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7235  -14.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1116  -13.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1604  -15.4776    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2849  -12.7527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0337  -12.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9493  -11.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1427  -11.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7288  -12.1361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8087  -10.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2950  -10.0018    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0134  -10.5802    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.5518   -9.8767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7484  -12.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4627  -12.4160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1773  -12.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917  -12.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1776  -13.6532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6062  -12.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6035  -13.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3172  -14.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0326  -13.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0296  -12.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3152  -12.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3110  -11.5878    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7478  -14.0617    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874740

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.23Molecular Weight (Monoisotopic): 445.0372AlogP: 5.20#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.61CX Basic pKa: CX LogP: 5.37CX LogD: 5.37
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -2.06

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source