8-(1-acetylpiperidin-4-yl)-5-((5-fluoro-2,3-dihydrobenzofuran-4-yl)methylamino)pyrido[3,4-d]pyridazin-1(2H)-one

ID: ALA4874749

PubChem CID: 164626987

Max Phase: Preclinical

Molecular Formula: C23H24FN5O3

Molecular Weight: 437.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC(c2cnc(NCc3c(F)ccc4c3CCO4)c3cn[nH]c(=O)c23)CC1

Standard InChI:  InChI=1S/C23H24FN5O3/c1-13(30)29-7-4-14(5-8-29)16-10-25-22(18-12-27-28-23(31)21(16)18)26-11-17-15-6-9-32-20(15)3-2-19(17)24/h2-3,10,12,14H,4-9,11H2,1H3,(H,25,26)(H,28,31)

Standard InChI Key:  XUMXPJUJQTVJDS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    9.3592  -16.1799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3592  -17.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0738  -17.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0738  -15.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0738  -14.9337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7909  -14.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7909  -13.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7939  -12.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0743  -12.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0776  -13.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5114  -12.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5099  -13.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2938  -13.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7797  -12.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2962  -12.2003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3620  -13.6998    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.0736  -18.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7849  -16.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7930  -17.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5070  -17.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2176  -16.9906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2096  -16.1662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4910  -15.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5139  -18.2354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3565  -18.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3543  -19.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0685  -19.8924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7865  -19.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7903  -18.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0651  -20.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3463  -21.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7805  -21.1373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3 19  1  0
 18  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7 12  2  0
 11  8  2  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
  3 17  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 20 24  2  0
 17 25  1  0
 17 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4874749

    ---

Associated Targets(Human)

EED Tchem Polycomb protein EED (645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.48Molecular Weight (Monoisotopic): 437.1863AlogP: 2.73#Rotatable Bonds: 4
Polar Surface Area: 100.21Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.57CX Basic pKa: 3.82CX LogP: 1.30CX LogD: 1.30
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.27

References

1. Bagal SK, Gregson C, O' Donovan DH, Pike KG, Bloecher A, Barton P, Borodovsky A, Code E, Fillery SM, Hsu JH, Kawatkar SP, Li C, Longmire D, Nai Y, Nash SC, Pike A, Robinson J, Read JA, Rawlins PB, Shen M, Tang J, Wang P, Woods H, Williamson B..  (2021)  Diverse, Potent, and Efficacious Inhibitors That Target the EED Subunit of the Polycomb Repressive Complex 2 Methyltransferase.,  64  (23.0): [PMID:34807608] [10.1021/acs.jmedchem.1c01161]

Source