The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-(5-(4-(dimethylamino)phenyl)-3-(4-(4-methylpiperazin-1-yl)phenyl)-4,5-dihydro-1H-pyrazol-1-yl)-3-oxopropanoate ID: ALA4874792
PubChem CID: 164627604
Max Phase: Preclinical
Molecular Formula: C26H33N5O3
Molecular Weight: 463.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CC(=O)N1N=C(c2ccc(N3CCN(C)CC3)cc2)CC1c1ccc(N(C)C)cc1
Standard InChI: InChI=1S/C26H33N5O3/c1-28(2)21-9-7-20(8-10-21)24-17-23(27-31(24)25(32)18-26(33)34-4)19-5-11-22(12-6-19)30-15-13-29(3)14-16-30/h5-12,24H,13-18H2,1-4H3
Standard InChI Key: KYQISTKPXQDMAN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
27.9349 -4.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5953 -4.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2584 -4.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0067 -3.4890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1904 -3.4905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0324 -4.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1988 -5.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9744 -5.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5843 -5.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4133 -4.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6379 -3.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1583 -4.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5527 -3.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7754 -4.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6025 -5.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2131 -5.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9881 -5.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8249 -5.2655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2185 -4.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6538 -6.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3610 -5.2887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7108 -2.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5246 -6.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2974 -6.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9087 -5.8047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7418 -5.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9637 -4.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6845 -6.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0440 -2.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8980 -2.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5645 -1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8977 -0.6749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7517 -1.5055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4182 -0.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
15 18 1 0
18 19 1 0
18 20 1 0
9 21 1 0
5 22 1 0
21 23 1 0
21 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
22 29 1 0
22 30 2 0
29 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.58Molecular Weight (Monoisotopic): 463.2583AlogP: 2.75#Rotatable Bonds: 6Polar Surface Area: 68.69Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.83CX Basic pKa: 7.83CX LogP: 3.00CX LogD: 2.43Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.29
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]