The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzo[d][1,3]dioxol-5-yl 5-(benzo[d][1,3]dioxol-5-yloxy)pentanoate ID: ALA4874794
PubChem CID: 155681719
Max Phase: Preclinical
Molecular Formula: C19H18O7
Molecular Weight: 358.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCOc1ccc2c(c1)OCO2)Oc1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C19H18O7/c20-19(26-14-5-7-16-18(10-14)25-12-23-16)3-1-2-8-21-13-4-6-15-17(9-13)24-11-22-15/h4-7,9-10H,1-3,8,11-12H2
Standard InChI Key: QKKAKRZHEBEUKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
4.1682 -19.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8820 -19.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -18.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1664 -17.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4561 -19.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4528 -18.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6711 -18.1034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1937 -18.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6764 -19.4287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5895 -17.9306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3028 -18.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0131 -17.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7224 -18.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4327 -17.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1460 -18.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8563 -17.9146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1491 -19.1513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5697 -18.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5701 -19.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9882 -18.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2751 -17.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9940 -19.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2869 -19.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4614 -20.3496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2764 -20.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6029 -19.6831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 18 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 358.35Molecular Weight (Monoisotopic): 358.1053AlogP: 3.30#Rotatable Bonds: 7Polar Surface Area: 72.45Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.31CX LogD: 3.31Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.43Np Likeness Score: -0.14
References 1. Xie YD, Xu YH, Liu JP, Wang B, Shi YH, Wang W, Wang XP, Sun M, Xu XY, Bian XL.. (2021) 1,3-Benzodioxole-based fibrate derivatives as potential hypolipidemic and hepatoprotective agents., 43 [PMID:33684440 ] [10.1016/j.bmcl.2021.127898 ]