N-(3-((5-chloro-2-((4-(diethylamino)-2-methoxyphenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide

ID: ALA4874862

PubChem CID: 164629036

Max Phase: Preclinical

Molecular Formula: C24H28ClN5O3

Molecular Weight: 469.97

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N(CC)CC)cc3OC)ncc2Cl)c1

Standard InChI:  InChI=1S/C24H28ClN5O3/c1-5-22(31)27-16-9-8-10-18(13-16)33-23-19(25)15-26-24(29-23)28-20-12-11-17(14-21(20)32-4)30(6-2)7-3/h8-15H,5-7H2,1-4H3,(H,27,31)(H,26,28,29)

Standard InChI Key:  AREIDTSBJAWMMJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   22.3929   -2.9097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3918   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0998   -4.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8095   -3.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8067   -2.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0980   -2.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6837   -4.1372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9764   -3.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5178   -4.1362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2249   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9815   -2.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2750   -2.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5660   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5680   -3.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2751   -4.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9299   -4.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6365   -3.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6357   -2.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9223   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2187   -2.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3447   -4.1332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0519   -3.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7601   -4.1317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4673   -3.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0510   -2.9067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8581   -2.5018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8576   -1.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1506   -2.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4426   -2.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1497   -1.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2780   -4.9540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5718   -5.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5128   -2.4948    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
  8 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  8  1  0
 10 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 10  1  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  2  0
 13 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 27 30  1  0
 15 31  1  0
 31 32  1  0
  5 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874862

    ---

Associated Targets(Human)

NUAK1 Tchem NUAK family SNF1-like kinase 1 (1769 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NUAK2 Tchem NUAK family SNF1-like kinase 2 (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U2OS (164939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.97Molecular Weight (Monoisotopic): 469.1881AlogP: 5.87#Rotatable Bonds: 10
Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.49CX Basic pKa: 5.65CX LogP: 5.47CX LogD: 5.46
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.82

References

1. Yang H, Wang X, Wang C, Yin F, Qu L, Shi C, Zhao J, Li S, Ji L, Peng W, Luo H, Cheng M, Kong L..  (2021)  Optimization of WZ4003 as NUAK inhibitors against human colorectal cancer.,  210  [PMID:33310286] [10.1016/j.ejmech.2020.113080]

Source