The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-chloro-2-((4-(diethylamino)-2-methoxyphenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide ID: ALA4874862
PubChem CID: 164629036
Max Phase: Preclinical
Molecular Formula: C24H28ClN5O3
Molecular Weight: 469.97
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N(CC)CC)cc3OC)ncc2Cl)c1
Standard InChI: InChI=1S/C24H28ClN5O3/c1-5-22(31)27-16-9-8-10-18(13-16)33-23-19(25)15-26-24(29-23)28-20-12-11-17(14-21(20)32-4)30(6-2)7-3/h8-15H,5-7H2,1-4H3,(H,27,31)(H,26,28,29)
Standard InChI Key: AREIDTSBJAWMMJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
22.3929 -2.9097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3918 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0998 -4.1382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8095 -3.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8067 -2.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0980 -2.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6837 -4.1372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9764 -3.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5178 -4.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2249 -3.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9815 -2.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2750 -2.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5660 -2.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5680 -3.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2751 -4.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9299 -4.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6365 -3.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6357 -2.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9223 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2187 -2.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3447 -4.1332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0519 -3.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7601 -4.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4673 -3.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0510 -2.9067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8581 -2.5018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8576 -1.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1506 -2.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4426 -2.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1497 -1.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2780 -4.9540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5718 -5.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5128 -2.4948 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
8 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 8 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 2 0
13 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
15 31 1 0
31 32 1 0
5 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.97Molecular Weight (Monoisotopic): 469.1881AlogP: 5.87#Rotatable Bonds: 10Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: 5.65CX LogP: 5.47CX LogD: 5.46Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.82
References 1. Yang H, Wang X, Wang C, Yin F, Qu L, Shi C, Zhao J, Li S, Ji L, Peng W, Luo H, Cheng M, Kong L.. (2021) Optimization of WZ4003 as NUAK inhibitors against human colorectal cancer., 210 [PMID:33310286 ] [10.1016/j.ejmech.2020.113080 ]