The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(aminomethyl)phenyl)-N-(5-(ethoxy(phenyl)methyl)-2-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA4874867
PubChem CID: 126665520
Max Phase: Preclinical
Molecular Formula: C27H24F4N4O2
Molecular Weight: 512.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(c1ccccc1)c1ccc(F)c(NC(=O)c2cc(C(F)(F)F)nn2-c2cccc(CN)c2)c1
Standard InChI: InChI=1S/C27H24F4N4O2/c1-2-37-25(18-8-4-3-5-9-18)19-11-12-21(28)22(14-19)33-26(36)23-15-24(27(29,30)31)34-35(23)20-10-6-7-17(13-20)16-32/h3-15,25H,2,16,32H2,1H3,(H,33,36)
Standard InChI Key: YVBRMUSUELCGNA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
13.5610 -15.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5599 -16.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2746 -16.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9911 -16.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9882 -15.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2728 -14.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7062 -16.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4200 -16.1496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2704 -14.0871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9304 -13.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6732 -12.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8481 -12.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5956 -13.6033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3612 -12.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6944 -11.3972 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5409 -12.2407 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7708 -11.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7165 -13.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8925 -14.6558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3264 -13.2943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1125 -13.5449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2852 -14.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0704 -14.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6814 -14.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5018 -13.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7169 -12.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5368 -12.1827 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2460 -15.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6357 -15.9612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0319 -15.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2057 -16.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9908 -16.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6020 -16.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4229 -15.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6381 -15.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8114 -16.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2011 -17.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
10 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
23 28 1 0
28 29 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
29 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.51Molecular Weight (Monoisotopic): 512.1835AlogP: 5.87#Rotatable Bonds: 8Polar Surface Area: 82.17Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.33CX Basic pKa: 9.25CX LogP: 5.62CX LogD: 3.79Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.48
References 1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS.. (2021) Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE)., 64 (17.0): [PMID:34436898 ] [10.1021/acs.jmedchem.1c00511 ]