1-(3-(aminomethyl)phenyl)-N-(5-(ethoxy(phenyl)methyl)-2-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA4874867

PubChem CID: 126665520

Max Phase: Preclinical

Molecular Formula: C27H24F4N4O2

Molecular Weight: 512.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(c1ccccc1)c1ccc(F)c(NC(=O)c2cc(C(F)(F)F)nn2-c2cccc(CN)c2)c1

Standard InChI:  InChI=1S/C27H24F4N4O2/c1-2-37-25(18-8-4-3-5-9-18)19-11-12-21(28)22(14-19)33-26(36)23-15-24(27(29,30)31)34-35(23)20-10-6-7-17(13-20)16-32/h3-15,25H,2,16,32H2,1H3,(H,33,36)

Standard InChI Key:  YVBRMUSUELCGNA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   13.5610  -15.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5599  -16.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2746  -16.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9911  -16.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9882  -15.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2728  -14.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7062  -16.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4200  -16.1496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2704  -14.0871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9304  -13.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6732  -12.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8481  -12.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5956  -13.6033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3612  -12.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6944  -11.3972    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.5409  -12.2407    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.7708  -11.5625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.7165  -13.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8925  -14.6558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3264  -13.2943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1125  -13.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2852  -14.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0704  -14.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6814  -14.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5018  -13.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7169  -12.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5368  -12.1827    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2460  -15.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6357  -15.9612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0319  -15.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2057  -16.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9908  -16.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6020  -16.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4229  -15.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6381  -15.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8114  -16.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2011  -17.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 23 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874867

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.51Molecular Weight (Monoisotopic): 512.1835AlogP: 5.87#Rotatable Bonds: 8
Polar Surface Area: 82.17Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.33CX Basic pKa: 9.25CX LogP: 5.62CX LogD: 3.79
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.48

References

1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS..  (2021)  Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE).,  64  (17.0): [PMID:34436898] [10.1021/acs.jmedchem.1c00511]

Source