The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Akuammiline ID: ALA4874877
PubChem CID: 164625689
Max Phase: Preclinical
Molecular Formula: C23H26N2O4
Molecular Weight: 394.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1/CN2CC[C@]34C(=Nc5ccccc53)[C@@H]2C[C@@H]1[C@@]4(COC(C)=O)C(=O)OC
Standard InChI: InChI=1S/C23H26N2O4/c1-4-15-12-25-10-9-22-16-7-5-6-8-18(16)24-20(22)19(25)11-17(15)23(22,21(27)28-3)13-29-14(2)26/h4-8,17,19H,9-13H2,1-3H3/b15-4-/t17-,19-,22+,23-/m0/s1
Standard InChI Key: QBHALCZZZWCCLV-XIPRXZKPSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
9.6644 -11.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2788 -12.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6498 -12.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4169 -11.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7869 -12.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3929 -12.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8983 -13.4262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5298 -12.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6008 -13.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8446 -12.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1477 -11.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9198 -12.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2982 -13.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3725 -14.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6916 -14.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6157 -13.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3722 -14.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4464 -15.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6416 -13.8150 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.5240 -11.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8751 -10.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6317 -10.9233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4767 -10.3091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0301 -11.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0208 -13.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0174 -14.5719 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.8212 -11.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8230 -10.3988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1259 -9.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1276 -9.1871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4271 -10.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 2 0
8 5 1 0
8 9 1 0
8 11 1 6
9 13 1 0
12 10 1 0
10 11 1 0
12 13 1 0
12 16 1 0
13 14 1 0
15 16 1 0
15 17 2 0
17 18 1 0
13 19 1 6
8 20 1 0
20 21 1 6
21 22 1 0
21 23 2 0
22 24 1 0
14 25 1 0
15 25 1 0
25 20 1 0
25 26 1 1
20 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.47Molecular Weight (Monoisotopic): 394.1893AlogP: 2.79#Rotatable Bonds: 3Polar Surface Area: 68.20Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.00CX LogP: 2.65CX LogD: 2.51Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: 2.38
References 1. Creed SM, Gutridge AM, Argade MD, Hennessy MR, Friesen JB, Pauli GF, van Rijn RM, Riley AP.. (2021) Isolation and Pharmacological Characterization of Six Opioidergic Picralima nitida Alkaloids., 84 (1.0): [PMID:33326237 ] [10.1021/acs.jnatprod.0c01036 ]